Difference between revisions of "CPD-10330"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=INDOLE_ACETALDEHYDE INDOLE_ACETALDEHYDE] == * smiles: ** C(CC1(C2(=C(NC=1)C=CC=C2)))=O * inchi...") |
|||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10330 CPD-10330] == |
* smiles: | * smiles: | ||
| − | ** C( | + | ** C(C1(C(C(C(O1)O)O)O))O |
| + | * molecular weight: | ||
| + | ** 150.131 | ||
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=HMFHBZSHGGEWLO-AIHAYLRMSA-N |
* common name: | * common name: | ||
| − | ** | + | ** α-D-ribofuranose |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** α D-ribose |
| − | + | ||
| − | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RIBOKIN-RXN]] |
| − | + | ||
| − | + | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | * | + | * CHEBI: |
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=45506 45506] | ||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=445894 445894] |
| − | + | ||
| − | + | ||
| − | + | ||
* CHEMSPIDER: | * CHEMSPIDER: | ||
| − | ** [http://www.chemspider.com/Chemical-Structure. | + | ** [http://www.chemspider.com/Chemical-Structure.5575.html 5575] |
| − | * | + | * HMDB : HMDB00283 |
| − | + | {{#set: smiles=C(C1(C(C(C(O1)O)O)O))O}} | |
| − | + | {{#set: molecular weight=150.131 }} | |
| − | {{#set: smiles=C( | + | {{#set: inchi key=InChIKey=HMFHBZSHGGEWLO-AIHAYLRMSA-N}} |
| − | {{#set: inchi key=InChIKey= | + | {{#set: common name=α-D-ribofuranose}} |
| − | {{#set: common name= | + | {{#set: common name=α D-ribose}} |
| − | + | {{#set: consumed by=RIBOKIN-RXN}} | |
| − | {{#set: common name= | + | |
| − | {{#set: consumed by= | + | |
Latest revision as of 14:58, 9 January 2019
Contents
Metabolite CPD-10330
- smiles:
- C(C1(C(C(C(O1)O)O)O))O
- molecular weight:
- 150.131
- inchi key:
- InChIKey=HMFHBZSHGGEWLO-AIHAYLRMSA-N
- common name:
- α-D-ribofuranose
- Synonym(s):
- α D-ribose
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
