Difference between revisions of "CHC T00009101001 1"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-548 CPD-548] == * smiles: ** C(NC(=O)C(CSC=O)NC(=O)CCC([N+])C(=O)[O-])C(=O)[O-] * inchi key...") |
|||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene CHC_T00009101001_1 == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[RXN-14917]] |
− | + | ** Source: [[orthology-galdieria.sulphuraria]] | |
− | == | + | * Reaction: [[RXN-2542]] |
− | * [[ | + | ** Source: [[orthology-galdieria.sulphuraria]] |
+ | * Reaction: [[RXN-2762]] | ||
+ | ** Source: [[orthology-galdieria.sulphuraria]] | ||
+ | == Pathways associated == | ||
+ | * [[PWY-1422]] | ||
+ | * [[PWY-6978]] | ||
+ | * [[PWY-1581]] | ||
+ | * [[PWY-7436]] | ||
== External links == | == External links == | ||
− | + | {{#set: reaction associated=RXN-14917|RXN-2542|RXN-2762}} | |
− | + | {{#set: pathway associated=PWY-1422|PWY-6978|PWY-1581|PWY-7436}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | {{#set: | + | |
− | + | ||
− | + | ||
− | + |
Latest revision as of 16:27, 9 January 2019
Gene CHC_T00009101001_1
- Synonym(s):
Reactions associated
- Reaction: RXN-14917
- Source: orthology-galdieria.sulphuraria
- Reaction: RXN-2542
- Source: orthology-galdieria.sulphuraria
- Reaction: RXN-2762
- Source: orthology-galdieria.sulphuraria