Difference between revisions of "CHC T00008733001 1"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6701 CPD-6701] == * smiles: ** C1(O)(C(O)C(O)C(OP(=O)([O-])[O-])C(O)C(O)1) * inchi key: **...")
 
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6701 CPD-6701] ==
+
== Gene CHC_T00008733001_1 ==
* smiles:
+
** C1(O)(C(O)C(O)C(OP(=O)([O-])[O-])C(O)C(O)1)
+
* inchi key:
+
** InChIKey=INAPMGSXUVUWAF-KXXVROSKSA-L
+
* common name:
+
** 1D-myo-inositol 5-monophosphate
+
* molecular weight:
+
** 258.121   
+
 
* Synonym(s):
 
* Synonym(s):
** D-myo-inositol 5-monophosphate
 
** Ins(5)P1
 
** 1D-myo-inositol 5-phosphate
 
** Ins(5)P
 
** Ins5P
 
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
* [[RXN-10953]]
+
* Reaction: [[MALATE-DEH-RXN]]
== Reaction(s) known to produce the compound ==
+
** Source: [[orthology-ectocarpus_siliculosus]]
== Reaction(s) of unknown directionality ==
+
** Source: [[orthology-arabidopsis_thaliana]]
 +
** Source: [[orthology-arabidopsis_thaliana]]
 +
** Source: [[orthology-arabidopsis_thaliana]]
 +
** Source: [[orthology-arabidopsis_thaliana]]
 +
== Pathways associated ==
 +
* [[PWY-7383]]
 +
* [[P108-PWY]]
 +
* [[FERMENTATION-PWY]]
 +
* [[PWY-5690]]
 +
* [[GLYOXYLATE-BYPASS]]
 +
* [[P105-PWY]]
 +
* [[PWY-5913]]
 +
* [[PWY-1622]]
 +
* [[PWY-7115]]
 +
* [[TCA]]
 +
* [[PWY-6728]]
 +
* [[P23-PWY]]
 +
* [[PWY-6969]]
 +
* [[PWY-5392]]
 +
* [[PWY66-398]]
 +
* [[PWY66-399]]
 +
* [[GLUCONEO-PWY]]
 +
* [[P42-PWY]]
 +
* [[MALATE-ASPARTATE-SHUTTLE-PWY]]
 +
* [[PWY-561]]
 
== External links  ==
 
== External links  ==
{{#set: smiles=C1(O)(C(O)C(O)C(OP(=O)([O-])[O-])C(O)C(O)1)}}
+
{{#set: reaction associated=MALATE-DEH-RXN}}
{{#set: inchi key=InChIKey=INAPMGSXUVUWAF-KXXVROSKSA-L}}
+
{{#set: pathway associated=PWY-7383|P108-PWY|FERMENTATION-PWY|PWY-5690|GLYOXYLATE-BYPASS|P105-PWY|PWY-5913|PWY-1622|PWY-7115|TCA|PWY-6728|P23-PWY|PWY-6969|PWY-5392|PWY66-398|PWY66-399|GLUCONEO-PWY|P42-PWY|MALATE-ASPARTATE-SHUTTLE-PWY|PWY-561}}
{{#set: common name=1D-myo-inositol 5-monophosphate}}
+
{{#set: molecular weight=258.121    }}
+
{{#set: common name=D-myo-inositol 5-monophosphate|Ins(5)P1|1D-myo-inositol 5-phosphate|Ins(5)P|Ins5P}}
+
{{#set: consumed by=RXN-10953}}
+

Latest revision as of 15:28, 9 January 2019

Gene CHC_T00008733001_1

  • Synonym(s):

Reactions associated

Pathways associated

External links