Difference between revisions of "CPD-7616"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=IMP IMP] == * smiles: ** C(OP(=O)([O-])[O-])C1(OC(C(O)C(O)1)N3(C=NC2(C(=O)NC=NC=23))) * inchi k...") |
|||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7616 CPD-7616] == |
* smiles: | * smiles: | ||
| − | ** C( | + | ** C(C1(C=C(C(=CC=1)O)O))=O |
| + | * molecular weight: | ||
| + | ** 138.123 | ||
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=IBGBGRVKPALMCQ-UHFFFAOYSA-N |
* common name: | * common name: | ||
| − | ** | + | ** 3,4-dihydroxybenzaldehyde |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** protocatechualdehyde |
| − | ** | + | ** 3,4-dihydroxybenzyl aldehyde |
| − | + | ** rancinamycin IV | |
| − | + | ||
| − | + | ||
| − | ** | + | |
| − | + | ||
| − | + | ||
| − | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-8872]] |
| − | + | ||
| − | + | ||
| − | + | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | |||
| − | |||
== External links == | == External links == | ||
| − | * | + | * CHEBI: |
| − | * | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=50205 50205] |
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=8768 8768] |
| − | + | ||
* LIGAND-CPD: | * LIGAND-CPD: | ||
| − | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?C16700 C16700] |
* CHEMSPIDER: | * CHEMSPIDER: | ||
| − | ** [http://www.chemspider.com/Chemical-Structure. | + | ** [http://www.chemspider.com/Chemical-Structure.8438.html 8438] |
| − | * | + | * HMDB : HMDB59965 |
| − | + | {{#set: smiles=C(C1(C=C(C(=CC=1)O)O))=O}} | |
| − | + | {{#set: molecular weight=138.123 }} | |
| − | {{#set: smiles=C( | + | {{#set: inchi key=InChIKey=IBGBGRVKPALMCQ-UHFFFAOYSA-N}} |
| − | + | {{#set: common name=3,4-dihydroxybenzaldehyde}} | |
| − | + | {{#set: common name=protocatechualdehyde|3,4-dihydroxybenzyl aldehyde|rancinamycin IV}} | |
| − | {{#set: molecular weight= | + | {{#set: produced by=RXN-8872}} |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 15:35, 9 January 2019
Contents
Metabolite CPD-7616
- smiles:
- C(C1(C=C(C(=CC=1)O)O))=O
- molecular weight:
- 138.123
- inchi key:
- InChIKey=IBGBGRVKPALMCQ-UHFFFAOYSA-N
- common name:
- 3,4-dihydroxybenzaldehyde
- Synonym(s):
- protocatechualdehyde
- 3,4-dihydroxybenzyl aldehyde
- rancinamycin IV
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
