Difference between revisions of "MALEAMATE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MALEAMATE MALEAMATE] == * smiles: ** C(=CC(=O)[O-])C(N)=O * inchi key: ** InChIKey=FSQQTNAZHBEJ...") |
|||
Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** C(=CC(=O)[O-])C(N)=O | ** C(=CC(=O)[O-])C(N)=O | ||
+ | * molecular weight: | ||
+ | ** 114.08 | ||
* inchi key: | * inchi key: | ||
** InChIKey=FSQQTNAZHBEJLS-UPHRSURJSA-M | ** InChIKey=FSQQTNAZHBEJLS-UPHRSURJSA-M | ||
* common name: | * common name: | ||
** maleamate | ** maleamate | ||
− | |||
− | |||
* Synonym(s): | * Synonym(s): | ||
** maleic acid monoamide | ** maleic acid monoamide | ||
Line 19: | Line 19: | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16146 16146] | ||
* CAS : 557-24-4 | * CAS : 557-24-4 | ||
* PUBCHEM: | * PUBCHEM: | ||
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5460391 5460391] | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5460391 5460391] | ||
− | |||
− | |||
− | |||
− | |||
* LIGAND-CPD: | * LIGAND-CPD: | ||
** [http://www.genome.jp/dbget-bin/www_bget?C01596 C01596] | ** [http://www.genome.jp/dbget-bin/www_bget?C01596 C01596] | ||
+ | * CHEMSPIDER: | ||
+ | ** [http://www.chemspider.com/Chemical-Structure.4573932.html 4573932] | ||
{{#set: smiles=C(=CC(=O)[O-])C(N)=O}} | {{#set: smiles=C(=CC(=O)[O-])C(N)=O}} | ||
+ | {{#set: molecular weight=114.08 }} | ||
{{#set: inchi key=InChIKey=FSQQTNAZHBEJLS-UPHRSURJSA-M}} | {{#set: inchi key=InChIKey=FSQQTNAZHBEJLS-UPHRSURJSA-M}} | ||
{{#set: common name=maleamate}} | {{#set: common name=maleamate}} | ||
− | |||
{{#set: common name=maleic acid monoamide|maleamic acid|(Z)-4-amino-4-oxo-but-2-enoate}} | {{#set: common name=maleic acid monoamide|maleamic acid|(Z)-4-amino-4-oxo-but-2-enoate}} | ||
{{#set: consumed by=RXN-646}} | {{#set: consumed by=RXN-646}} |
Latest revision as of 15:21, 9 January 2019
Contents
Metabolite MALEAMATE
- smiles:
- C(=CC(=O)[O-])C(N)=O
- molecular weight:
- 114.08
- inchi key:
- InChIKey=FSQQTNAZHBEJLS-UPHRSURJSA-M
- common name:
- maleamate
- Synonym(s):
- maleic acid monoamide
- maleamic acid
- (Z)-4-amino-4-oxo-but-2-enoate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(=CC(=O)[O-])C(N)=O" cannot be used as a page name in this wiki.