Difference between revisions of "NMNH"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=NMNH NMNH] == * smiles: ** C1(=C(CC=CN1C2(OC(COP(=O)([O-])[O-])C(O)C(O)2))C(N)=O) * inchi key:...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** C1(=C(CC=CN1C2(OC(COP(=O)([O-])[O-])C(O)C(O)2))C(N)=O) | ** C1(=C(CC=CN1C2(OC(COP(=O)([O-])[O-])C(O)C(O)2))C(N)=O) | ||
| + | * molecular weight: | ||
| + | ** 334.222 | ||
* inchi key: | * inchi key: | ||
** InChIKey=XQHMUSRSLNRVGA-TURQNECASA-L | ** InChIKey=XQHMUSRSLNRVGA-TURQNECASA-L | ||
* common name: | * common name: | ||
** reduced β-nicotinamide D-ribonucleotide | ** reduced β-nicotinamide D-ribonucleotide | ||
| − | |||
| − | |||
* Synonym(s): | * Synonym(s): | ||
** nicotinamide mononucleotide (reduced) | ** nicotinamide mononucleotide (reduced) | ||
| Line 18: | Line 18: | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | |||
| − | |||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=90832 90832] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=90832 90832] | ||
| + | * PUBCHEM: | ||
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25246098 25246098] | ||
{{#set: smiles=C1(=C(CC=CN1C2(OC(COP(=O)([O-])[O-])C(O)C(O)2))C(N)=O)}} | {{#set: smiles=C1(=C(CC=CN1C2(OC(COP(=O)([O-])[O-])C(O)C(O)2))C(N)=O)}} | ||
| + | {{#set: molecular weight=334.222 }} | ||
{{#set: inchi key=InChIKey=XQHMUSRSLNRVGA-TURQNECASA-L}} | {{#set: inchi key=InChIKey=XQHMUSRSLNRVGA-TURQNECASA-L}} | ||
{{#set: common name=reduced β-nicotinamide D-ribonucleotide}} | {{#set: common name=reduced β-nicotinamide D-ribonucleotide}} | ||
| − | |||
{{#set: common name=nicotinamide mononucleotide (reduced)|NMNH}} | {{#set: common name=nicotinamide mononucleotide (reduced)|NMNH}} | ||
{{#set: produced by=RXN0-4401}} | {{#set: produced by=RXN0-4401}} | ||
Latest revision as of 15:22, 9 January 2019
Contents
Metabolite NMNH
- smiles:
- C1(=C(CC=CN1C2(OC(COP(=O)([O-])[O-])C(O)C(O)2))C(N)=O)
- molecular weight:
- 334.222
- inchi key:
- InChIKey=XQHMUSRSLNRVGA-TURQNECASA-L
- common name:
- reduced β-nicotinamide D-ribonucleotide
- Synonym(s):
- nicotinamide mononucleotide (reduced)
- NMNH
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C1(=C(CC=CN1C2(OC(COP(=O)([O-])[O-])C(O)C(O)2))C(N)=O)" cannot be used as a page name in this wiki.
