Difference between revisions of "ADP-D-Ribosyl-Acceptors"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GUANOSINE-5DP-3DP GUANOSINE-5DP-3DP] == * smiles: ** C(OP(=O)([O-])OP(=O)(O)[O-])C1(OC(C(O)C(OP...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ADP-D-Ribosyl-Acceptors ADP-D-Ribosyl-Acceptors] == * common name: ** an ADP-D-ribosyl acceptor...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GUANOSINE-5DP-3DP GUANOSINE-5DP-3DP] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ADP-D-Ribosyl-Acceptors ADP-D-Ribosyl-Acceptors] ==
* smiles:
+
** C(OP(=O)([O-])OP(=O)(O)[O-])C1(OC(C(O)C(OP([O-])(=O)OP([O-])([O-])=O)1)N3(C=NC2(C(=O)NC(N)=NC=23)))
+
* inchi key:
+
** InChIKey=BUFLLCUFNHESEH-UUOKFMHZSA-I
+
 
* common name:
 
* common name:
** ppGpp
+
** an ADP-D-ribosyl acceptor
* molecular weight:
+
** 598.123   
+
 
* Synonym(s):
 
* Synonym(s):
** guanosine tetraphosphate
 
** guanosine 5'-diphosphate,3'-diphosphate
 
** guanosine 3',5'-bispyrophosphate
 
** guanosine 3',5'-bis(diphosphate)
 
** guanosine 3'-diphosphate 5'-diphosphate
 
** magic spot
 
** guanosine-5',3'-tetraphosphate
 
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[PPGPPSYN-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 +
* [[NAD+-ADP-RIBOSYLTRANSFERASE-RXN]]
 
== External links  ==
 
== External links  ==
* DRUGBANK : DB04022
+
{{#set: common name=an ADP-D-ribosyl acceptor}}
* PUBCHEM:
+
{{#set: reversible reaction associated=NAD+-ADP-RIBOSYLTRANSFERASE-RXN}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=15938967 15938967]
+
* HMDB : HMDB59638
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C01228 C01228]
+
* CHEMSPIDER:
+
** [http://www.chemspider.com/Chemical-Structure.13082026.html 13082026]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=77828 77828]
+
* BIGG : ppgpp
+
{{#set: smiles=C(OP(=O)([O-])OP(=O)(O)[O-])C1(OC(C(O)C(OP([O-])(=O)OP([O-])([O-])=O)1)N3(C=NC2(C(=O)NC(N)=NC=23)))}}
+
{{#set: inchi key=InChIKey=BUFLLCUFNHESEH-UUOKFMHZSA-I}}
+
{{#set: common name=ppGpp}}
+
{{#set: molecular weight=598.123    }}
+
{{#set: common name=guanosine tetraphosphate|guanosine 5'-diphosphate,3'-diphosphate|guanosine 3',5'-bispyrophosphate|guanosine 3',5'-bis(diphosphate)|guanosine 3'-diphosphate 5'-diphosphate|magic spot|guanosine-5',3'-tetraphosphate}}
+
{{#set: consumed by=PPGPPSYN-RXN}}
+

Latest revision as of 15:10, 23 May 2018

Metabolite ADP-D-Ribosyl-Acceptors

  • common name:
    • an ADP-D-ribosyl acceptor
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links