Difference between revisions of "CPD-15152"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=1TRANSKETO-RXN-CPD-19339/GAP//RIBOSE-5P/XYLULOSE-5-PHOSPHATE.46. 1TRANSKETO-RXN-CPD-19339/GAP//RIBO...") |
|||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15152 CPD-15152] == |
− | * | + | * smiles: |
− | ** | + | ** CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC1(C(=O)C(OC)=CC(=O)C=1) |
+ | * molecular weight: | ||
+ | ** 683.068 | ||
+ | * inchi key: | ||
+ | ** InChIKey=AFTBILPWMUSGIN-MYCGWMCTSA-N | ||
+ | * common name: | ||
+ | ** 6-methoxy-2-all-trans-octaprenyl-1,4-benzoquinone | ||
* Synonym(s): | * Synonym(s): | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | * | + | * [[RXN-14177]] |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=28423 28423] |
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5280835 5280835] |
− | {{#set: | + | * LIGAND-CPD: |
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C05813 C05813] | ||
+ | {{#set: smiles=CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC1(C(=O)C(OC)=CC(=O)C=1)}} | ||
+ | {{#set: molecular weight=683.068 }} | ||
+ | {{#set: inchi key=InChIKey=AFTBILPWMUSGIN-MYCGWMCTSA-N}} | ||
+ | {{#set: common name=6-methoxy-2-all-trans-octaprenyl-1,4-benzoquinone}} | ||
+ | {{#set: consumed by=RXN-14177}} |
Latest revision as of 15:37, 9 January 2019
Contents
Metabolite CPD-15152
- smiles:
- CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC1(C(=O)C(OC)=CC(=O)C=1)
- molecular weight:
- 683.068
- inchi key:
- InChIKey=AFTBILPWMUSGIN-MYCGWMCTSA-N
- common name:
- 6-methoxy-2-all-trans-octaprenyl-1,4-benzoquinone
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links