Difference between revisions of "TRNA-containing-5Me-uridine54"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7616 CPD-7616] == * smiles: ** C(C1(C=C(C(=CC=1)O)O))=O * inchi key: ** InChIKey=IBGBGRVKPA...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=tRNA-containing-5Me-uridine54 tRNA-containing-5Me-uridine54] == * common name: ** a 5-methylura...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7616 CPD-7616] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=tRNA-containing-5Me-uridine54 tRNA-containing-5Me-uridine54] ==
* smiles:
+
** C(C1(C=C(C(=CC=1)O)O))=O
+
* inchi key:
+
** InChIKey=IBGBGRVKPALMCQ-UHFFFAOYSA-N
+
 
* common name:
 
* common name:
** 3,4-dihydroxybenzaldehyde
+
** a 5-methyluracil54 in tRNA
* molecular weight:
+
** 138.123   
+
 
* Synonym(s):
 
* Synonym(s):
** protocatechualdehyde
+
** a tRNA containing 5-methyluracil54
** 3,4-dihydroxybenzyl aldehyde
+
** rancinamycin IV
+
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-8872]]
+
* [[TRNA-URACIL-5--METHYLTRANSFERASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=a 5-methyluracil54 in tRNA}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=8768 8768]
+
{{#set: common name=a tRNA containing 5-methyluracil54}}
* CHEMSPIDER:
+
{{#set: produced by=TRNA-URACIL-5--METHYLTRANSFERASE-RXN}}
** [http://www.chemspider.com/Chemical-Structure.8438.html 8438]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=50205 50205]
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C16700 C16700]
+
* HMDB : HMDB59965
+
{{#set: smiles=C(C1(C=C(C(=CC=1)O)O))=O}}
+
{{#set: inchi key=InChIKey=IBGBGRVKPALMCQ-UHFFFAOYSA-N}}
+
{{#set: common name=3,4-dihydroxybenzaldehyde}}
+
{{#set: molecular weight=138.123    }}
+
{{#set: common name=protocatechualdehyde|3,4-dihydroxybenzyl aldehyde|rancinamycin IV}}
+
{{#set: produced by=RXN-8872}}
+

Latest revision as of 16:11, 23 May 2018

Metabolite tRNA-containing-5Me-uridine54

  • common name:
    • a 5-methyluracil54 in tRNA
  • Synonym(s):
    • a tRNA containing 5-methyluracil54

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links