Difference between revisions of "CPD-15172"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15172 CPD-15172] == * smiles: ** C1(C=CC(=CC=1)C2(=CC(=O)C3(C(O2)=CC(=O)C(=O)C(O)=3))) * in...") |
|||
Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** C1(C=CC(=CC=1)C2(=CC(=O)C3(C(O2)=CC(=O)C(=O)C(O)=3))) | ** C1(C=CC(=CC=1)C2(=CC(=O)C3(C(O2)=CC(=O)C(=O)C(O)=3))) | ||
+ | * molecular weight: | ||
+ | ** 268.225 | ||
* inchi key: | * inchi key: | ||
** InChIKey=LSQWCIYRGVWPFX-UHFFFAOYSA-N | ** InChIKey=LSQWCIYRGVWPFX-UHFFFAOYSA-N | ||
* common name: | * common name: | ||
** 6,7-dehydrobaicalein | ** 6,7-dehydrobaicalein | ||
− | |||
− | |||
* Synonym(s): | * Synonym(s): | ||
Line 19: | Line 19: | ||
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=86200952 86200952] | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=86200952 86200952] | ||
{{#set: smiles=C1(C=CC(=CC=1)C2(=CC(=O)C3(C(O2)=CC(=O)C(=O)C(O)=3)))}} | {{#set: smiles=C1(C=CC(=CC=1)C2(=CC(=O)C3(C(O2)=CC(=O)C(=O)C(O)=3)))}} | ||
+ | {{#set: molecular weight=268.225 }} | ||
{{#set: inchi key=InChIKey=LSQWCIYRGVWPFX-UHFFFAOYSA-N}} | {{#set: inchi key=InChIKey=LSQWCIYRGVWPFX-UHFFFAOYSA-N}} | ||
{{#set: common name=6,7-dehydrobaicalein}} | {{#set: common name=6,7-dehydrobaicalein}} | ||
− | |||
{{#set: produced by=RXN-14240}} | {{#set: produced by=RXN-14240}} |
Latest revision as of 16:46, 9 January 2019
Contents
Metabolite CPD-15172
- smiles:
- C1(C=CC(=CC=1)C2(=CC(=O)C3(C(O2)=CC(=O)C(=O)C(O)=3)))
- molecular weight:
- 268.225
- inchi key:
- InChIKey=LSQWCIYRGVWPFX-UHFFFAOYSA-N
- common name:
- 6,7-dehydrobaicalein
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM: