Difference between revisions of "3-oxo-myristoyl-ACPs"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PREGNENOLONE PREGNENOLONE] == * smiles: ** CC(=O)[CH]3(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]2CCC...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-oxo-myristoyl-ACPs 3-oxo-myristoyl-ACPs] == * common name: ** a 3-oxo-myristoyl-[acp] * Synon...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PREGNENOLONE PREGNENOLONE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-oxo-myristoyl-ACPs 3-oxo-myristoyl-ACPs] ==
−
* smiles:
+
−
** CC(=O)[CH]3(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))
+
−
* inchi key:
+
−
** InChIKey=ORNBQBCIOKFOEO-QGVNFLHTSA-N
+
 
* common name:
 
* common name:
−
** pregnenolone
+
** a 3-oxo-myristoyl-[acp]
−
* molecular weight:
+
−
** 316.483   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 1-[(3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,10,11,12,13,14,15,16, 17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)]ethanone
+
** a 3-oxo-tetradecanoyl-[acp]
−
** 5-pregnen-3-β-ol-20-one
+
** a 3-keto-myristoyl-[acp]
−
** 3-β-hydroxypregn-5-en-20-one
+
** a 3-oxo-tetradecanoyl-[acyl-carrier protein]
−
** 3beta-hydroxypregn-5-en-20-one
+
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[RXN66-353]]
+
* [[RXN-9536]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-9535]]
 +
* [[RXN-9653]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
−
* DRUGBANK : DB02789
+
{{#set: common name=a 3-oxo-myristoyl-[acp]}}
−
* CAS : 145-13-1
+
{{#set: common name=a 3-oxo-tetradecanoyl-[acp]|a 3-keto-myristoyl-[acp]|a 3-oxo-tetradecanoyl-[acyl-carrier protein]}}
−
* Wikipedia : Pregnenolone
+
{{#set: consumed by=RXN-9536}}
−
* LIPID_MAPS : LMST02030088
+
{{#set: produced by=RXN-9535|RXN-9653}}
−
* PUBCHEM:
+
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=8955 8955]
+
−
* HMDB : HMDB00253
+
−
* LIGAND-CPD:
+
−
** [http://www.genome.jp/dbget-bin/www_bget?C01953 C01953]
+
−
* CHEMSPIDER:
+
−
** [http://www.chemspider.com/Chemical-Structure.8611.html 8611]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16581 16581]
+
−
* METABOLIGHTS : MTBLC16581
+
−
{{#set: smiles=CC(=O)[CH]3(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))}}
+
−
{{#set: inchi key=InChIKey=ORNBQBCIOKFOEO-QGVNFLHTSA-N}}
+
−
{{#set: common name=pregnenolone}}
+
−
{{#set: molecular weight=316.483    }}
+
−
{{#set: common name=1-[(3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,10,11,12,13,14,15,16, 17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)]ethanone|5-pregnen-3-β-ol-20-one|3-β-hydroxypregn-5-en-20-one|3beta-hydroxypregn-5-en-20-one}}
+
−
{{#set: consumed by=RXN66-353}}
+

Latest revision as of 15:11, 23 May 2018

Metabolite 3-oxo-myristoyl-ACPs

  • common name:
    • a 3-oxo-myristoyl-[acp]
  • Synonym(s):
    • a 3-oxo-tetradecanoyl-[acp]
    • a 3-keto-myristoyl-[acp]
    • a 3-oxo-tetradecanoyl-[acyl-carrier protein]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"a 3-oxo-myristoyl-[acp" cannot be used as a page name in this wiki.
  • "a 3-oxo-tetradecanoyl-[acp" cannot be used as a page name in this wiki.
  • "a 3-keto-myristoyl-[acp" cannot be used as a page name in this wiki.
  • "a 3-oxo-tetradecanoyl-[acyl-carrier protein" cannot be used as a page name in this wiki.


Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=3-oxo-myristoyl-ACPs&oldid=13588"