Difference between revisions of "PYRIDNUCSYN-PWY"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=UDP UDP] == * smiles: ** C(OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(C(O)C(O)1)N2(C=CC(=O)NC(=O)2)) *...") |
|||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PYRIDNUCSYN-PWY PYRIDNUCSYN-PWY] == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** NAD biosynthesis I (from aspartate) |
| − | * | + | * taxonomic range: |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759] |
| + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** nicotinamide adenine dinucleotide biosynthesis |
| − | + | ||
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | + | '''2''' reactions found over '''6''' reactions in the full pathway | |
| − | * [[ | + | * [[NAD-SYNTH-GLN-RXN]] |
| − | + | ** 2 associated gene(s): | |
| − | + | *** [[CHC_T00008954001]] | |
| − | * | + | *** [[CHC_T00008954001_1]] |
| − | + | ** 4 reconstruction source(s) associated: | |
| − | * [[ | + | *** [[orthology-galdieria.sulphuraria]] |
| − | * [[ | + | *** [[annotation-original_genome]] |
| − | * | + | *** [[orthology-arabidopsis_thaliana]] |
| − | * [[ | + | *** [[orthology-ectocarpus_siliculosus]] |
| − | * | + | * [[QUINOPRIBOTRANS-RXN]] |
| − | * [[ | + | ** 3 associated gene(s): |
| − | * [[ | + | *** [[CHC_T00004416001_1]] |
| − | * [[ | + | *** [[CHC_T00009179001_1]] |
| − | * [[ | + | *** [[CHC_T00000718001_1]] |
| − | * | + | ** 3 reconstruction source(s) associated: |
| − | * [[ | + | *** [[orthology-galdieria.sulphuraria]] |
| − | * | + | *** [[orthology-arabidopsis_thaliana]] |
| − | * [[ | + | *** [[orthology-ectocarpus_siliculosus]] |
| − | * [[ | + | == Reaction(s) not found == |
| − | * | + | * [http://metacyc.org/META/NEW-IMAGE?object=L-ASPARTATE-OXID-RXN L-ASPARTATE-OXID-RXN] |
| − | * [[ | + | * [http://metacyc.org/META/NEW-IMAGE?object=NAD-SYNTH-NH3-RXN NAD-SYNTH-NH3-RXN] |
| − | + | * [http://metacyc.org/META/NEW-IMAGE?object=NICONUCADENYLYLTRAN-RXN NICONUCADENYLYLTRAN-RXN] | |
| − | * [[ | + | * [http://metacyc.org/META/NEW-IMAGE?object=QUINOLINATE-SYNTHA-RXN QUINOLINATE-SYNTHA-RXN] |
| − | * [[ | + | |
| − | == Reaction(s) | + | |
| − | * [[ | + | |
| − | * [ | + | |
| − | * [ | + | |
== External links == | == External links == | ||
| − | * | + | * ECOCYC: |
| − | + | ** [http://metacyc.org/ECOLI/NEW-IMAGE?object=PYRIDNUCSYN-PWY PYRIDNUCSYN-PWY] | |
| − | + | * ARACYC: | |
| − | ** [http:// | + | ** [http://metacyc.org/ARA/NEW-IMAGE?object=PYRIDNUCSYN-PWY PYRIDNUCSYN-PWY] |
| − | + | {{#set: common name=NAD biosynthesis I (from aspartate)}} | |
| − | + | {{#set: taxonomic range=TAX-2759}} | |
| − | + | {{#set: taxonomic range=TAX-2}} | |
| − | + | {{#set: common name=nicotinamide adenine dinucleotide biosynthesis}} | |
| − | * | + | {{#set: reaction found=2}} |
| − | ** [http:// | + | {{#set: total reaction=6}} |
| − | + | {{#set: completion rate=33.0}} | |
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | + | ||
| − | {{#set: common name= | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 15:31, 9 January 2019
Pathway PYRIDNUCSYN-PWY
- common name:
- NAD biosynthesis I (from aspartate)
- taxonomic range:
- Synonym(s):
- nicotinamide adenine dinucleotide biosynthesis
Reaction(s) found
2 reactions found over 6 reactions in the full pathway
- NAD-SYNTH-GLN-RXN
- 2 associated gene(s):
- 4 reconstruction source(s) associated:
- QUINOPRIBOTRANS-RXN
- 3 associated gene(s):
- 3 reconstruction source(s) associated:
Reaction(s) not found
External links
- ECOCYC:
- ARACYC:
