Difference between revisions of "CPD-12575"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12575 CPD-12575] == * smiles: ** C(O)C1(C(O)C(O)C(O)C(O1)OP(OP(=O)([O-])OCC2(OC(C(O)C(O)2)N...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** C(O)C1(C(O)C(O)C(O)C(O1)OP(OP(=O)([O-])OCC2(OC(C(O)C(O)2)N3(C=CC(=O)NC(=O)3)))([O-])=O) | ** C(O)C1(C(O)C(O)C(O)C(O1)OP(OP(=O)([O-])OCC2(OC(C(O)C(O)2)N3(C=CC(=O)NC(=O)3)))([O-])=O) | ||
| + | * molecular weight: | ||
| + | ** 564.289 | ||
* inchi key: | * inchi key: | ||
** InChIKey=HSCJRCZFDFQWRP-JZMIEXBBSA-L | ** InChIKey=HSCJRCZFDFQWRP-JZMIEXBBSA-L | ||
* common name: | * common name: | ||
** UDP-α-D-glucose | ** UDP-α-D-glucose | ||
| − | |||
| − | |||
* Synonym(s): | * Synonym(s): | ||
** UDPG | ** UDPG | ||
| Line 15: | Line 15: | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-4726]] |
| + | * [[RXN-7828]] | ||
* [[RXN-1223]] | * [[RXN-1223]] | ||
| + | * [[RXN-15117]] | ||
* [[TREHALOSE6PSYN-RXN]] | * [[TREHALOSE6PSYN-RXN]] | ||
| − | * [[RXN- | + | * [[RXN-4733]] |
| − | * [[ | + | * [[UGD-RXN]] |
| − | + | ||
* [[RXN1F-461]] | * [[RXN1F-461]] | ||
* [[RXN1F-462]] | * [[RXN1F-462]] | ||
| − | * [[RXN- | + | * [[RXN-8228]] |
| − | + | ||
| − | + | ||
* [[CELLULOSE-SYNTHASE-UDP-FORMING-RXN]] | * [[CELLULOSE-SYNTHASE-UDP-FORMING-RXN]] | ||
| + | * [[RXN-7668]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | |||
* [[GLUC1PURIDYLTRANS-RXN]] | * [[GLUC1PURIDYLTRANS-RXN]] | ||
| + | * [[GALACTURIDYLYLTRANS-RXN]] | ||
* [[UDPGLUCEPIM-RXN]] | * [[UDPGLUCEPIM-RXN]] | ||
== External links == | == External links == | ||
| − | |||
| − | |||
| − | |||
| − | |||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58885 58885] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58885 58885] | ||
| Line 42: | Line 38: | ||
* PUBCHEM: | * PUBCHEM: | ||
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=16667346 16667346] | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=16667346 16667346] | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C00029 C00029] | ||
| + | * CHEMSPIDER: | ||
| + | ** [http://www.chemspider.com/Chemical-Structure.10239191.html 10239191] | ||
{{#set: smiles=C(O)C1(C(O)C(O)C(O)C(O1)OP(OP(=O)([O-])OCC2(OC(C(O)C(O)2)N3(C=CC(=O)NC(=O)3)))([O-])=O)}} | {{#set: smiles=C(O)C1(C(O)C(O)C(O)C(O1)OP(OP(=O)([O-])OCC2(OC(C(O)C(O)2)N3(C=CC(=O)NC(=O)3)))([O-])=O)}} | ||
| + | {{#set: molecular weight=564.289 }} | ||
{{#set: inchi key=InChIKey=HSCJRCZFDFQWRP-JZMIEXBBSA-L}} | {{#set: inchi key=InChIKey=HSCJRCZFDFQWRP-JZMIEXBBSA-L}} | ||
{{#set: common name=UDP-α-D-glucose}} | {{#set: common name=UDP-α-D-glucose}} | ||
| − | |||
{{#set: common name=UDPG|UDP-glucose|UDP-D-glucose}} | {{#set: common name=UDPG|UDP-glucose|UDP-D-glucose}} | ||
| − | {{#set: consumed by= | + | {{#set: consumed by=RXN-4726|RXN-7828|RXN-1223|RXN-15117|TREHALOSE6PSYN-RXN|RXN-4733|UGD-RXN|RXN1F-461|RXN1F-462|RXN-8228|CELLULOSE-SYNTHASE-UDP-FORMING-RXN|RXN-7668}} |
| − | {{#set: reversible reaction associated= | + | {{#set: reversible reaction associated=GLUC1PURIDYLTRANS-RXN|GALACTURIDYLYLTRANS-RXN|UDPGLUCEPIM-RXN}} |
Latest revision as of 15:52, 9 January 2019
Contents
Metabolite CPD-12575
- smiles:
- C(O)C1(C(O)C(O)C(O)C(O1)OP(OP(=O)([O-])OCC2(OC(C(O)C(O)2)N3(C=CC(=O)NC(=O)3)))([O-])=O)
- molecular weight:
- 564.289
- inchi key:
- InChIKey=HSCJRCZFDFQWRP-JZMIEXBBSA-L
- common name:
- UDP-α-D-glucose
- Synonym(s):
- UDPG
- UDP-glucose
- UDP-D-glucose
Reaction(s) known to consume the compound
- RXN-4726
- RXN-7828
- RXN-1223
- RXN-15117
- TREHALOSE6PSYN-RXN
- RXN-4733
- UGD-RXN
- RXN1F-461
- RXN1F-462
- RXN-8228
- CELLULOSE-SYNTHASE-UDP-FORMING-RXN
- RXN-7668
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(O)C1(C(O)C(O)C(O)C(O1)OP(OP(=O)([O-])OCC2(OC(C(O)C(O)2)N3(C=CC(=O)NC(=O)3)))([O-])=O)" cannot be used as a page name in this wiki.
