Difference between revisions of "GMP"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Cis-Delta7-tetradecenoyl-ACPs Cis-Delta7-tetradecenoyl-ACPs] == * common name: ** a cis-Δ...") |
|||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GMP GMP] == |
| + | * smiles: | ||
| + | ** C(OP(=O)([O-])[O-])C1(OC(C(O)C(O)1)N3(C=NC2(C(=O)NC(N)=NC=23))) | ||
| + | * molecular weight: | ||
| + | ** 361.207 | ||
| + | * inchi key: | ||
| + | ** InChIKey=RQFCJASXJCIDSX-UUOKFMHZSA-L | ||
* common name: | * common name: | ||
| − | ** | + | ** GMP |
* Synonym(s): | * Synonym(s): | ||
| + | ** guanylate | ||
| + | ** guanylic acid | ||
| + | ** guanosine phosphate | ||
| + | ** guanosine 5'-phosphate | ||
| + | ** guanosine monophosphate | ||
| + | ** guanosine-5'-monophosphate | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-7609]] |
| + | * [[GUANYL-KIN-RXN]] | ||
| + | * [[GMP-REDUCT-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[GMP-SYN-NH3-RXN]] |
| + | * [[RXN-14140]] | ||
| + | * [[GUANOSINE-DIPHOSPHATASE-RXN]] | ||
| + | * [[RXN-14201]] | ||
| + | * [[GMP-SYN-GLUT-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| + | * [[GUANPRIBOSYLTRAN-RXN]] | ||
== External links == | == External links == | ||
| − | {{#set: common name= | + | * METABOLIGHTS : MTBLC58115 |
| − | {{#set: consumed by=RXN- | + | * BIGG : gmp |
| − | {{#set: produced by=RXN- | + | * CAS : 85-32-5 |
| + | * HMDB : HMDB01397 | ||
| + | * CHEMSPIDER: | ||
| + | ** [http://www.chemspider.com/Chemical-Structure.1413162.html 1413162] | ||
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58115 58115] | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C00144 C00144] | ||
| + | * PUBCHEM: | ||
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=1807035 1807035] | ||
| + | {{#set: smiles=C(OP(=O)([O-])[O-])C1(OC(C(O)C(O)1)N3(C=NC2(C(=O)NC(N)=NC=23)))}} | ||
| + | {{#set: molecular weight=361.207 }} | ||
| + | {{#set: inchi key=InChIKey=RQFCJASXJCIDSX-UUOKFMHZSA-L}} | ||
| + | {{#set: common name=GMP}} | ||
| + | {{#set: common name=guanylate|guanylic acid|guanosine phosphate|guanosine 5'-phosphate|guanosine monophosphate|guanosine-5'-monophosphate}} | ||
| + | {{#set: consumed by=RXN-7609|GUANYL-KIN-RXN|GMP-REDUCT-RXN}} | ||
| + | {{#set: produced by=GMP-SYN-NH3-RXN|RXN-14140|GUANOSINE-DIPHOSPHATASE-RXN|RXN-14201|GMP-SYN-GLUT-RXN}} | ||
| + | {{#set: reversible reaction associated=GUANPRIBOSYLTRAN-RXN}} | ||
Latest revision as of 15:39, 9 January 2019
Contents
Metabolite GMP
- smiles:
- C(OP(=O)([O-])[O-])C1(OC(C(O)C(O)1)N3(C=NC2(C(=O)NC(N)=NC=23)))
- molecular weight:
- 361.207
- inchi key:
- InChIKey=RQFCJASXJCIDSX-UUOKFMHZSA-L
- common name:
- GMP
- Synonym(s):
- guanylate
- guanylic acid
- guanosine phosphate
- guanosine 5'-phosphate
- guanosine monophosphate
- guanosine-5'-monophosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- METABOLIGHTS : MTBLC58115
- BIGG : gmp
- CAS : 85-32-5
- HMDB : HMDB01397
- CHEMSPIDER:
- CHEBI:
- LIGAND-CPD:
- PUBCHEM:
"C(OP(=O)([O-])[O-])C1(OC(C(O)C(O)1)N3(C=NC2(C(=O)NC(N)=NC=23)))" cannot be used as a page name in this wiki.
