Difference between revisions of "CPD-12117"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12117 CPD-12117] == * smiles: ** CC(=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC1(C...") |
|||
Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** CC(=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC1(C=C(O)C2(C=CC=CC(C(O)=1)=2)))C | ** CC(=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC1(C=C(O)C2(C=CC=CC(C(O)=1)=2)))C | ||
+ | * molecular weight: | ||
+ | ** 636.999 | ||
* inchi key: | * inchi key: | ||
** InChIKey=UFZDIMBXTVRBDS-SSQLMYNASA-N | ** InChIKey=UFZDIMBXTVRBDS-SSQLMYNASA-N | ||
* common name: | * common name: | ||
** demethylmenaquinol-7 | ** demethylmenaquinol-7 | ||
− | |||
− | |||
* Synonym(s): | * Synonym(s): | ||
** DMKH2-7 | ** DMKH2-7 | ||
Line 17: | Line 17: | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | |||
− | |||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=64806 64806] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=64806 64806] | ||
+ | * PUBCHEM: | ||
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45479205 45479205] | ||
{{#set: smiles=CC(=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC1(C=C(O)C2(C=CC=CC(C(O)=1)=2)))C}} | {{#set: smiles=CC(=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC1(C=C(O)C2(C=CC=CC(C(O)=1)=2)))C}} | ||
+ | {{#set: molecular weight=636.999 }} | ||
{{#set: inchi key=InChIKey=UFZDIMBXTVRBDS-SSQLMYNASA-N}} | {{#set: inchi key=InChIKey=UFZDIMBXTVRBDS-SSQLMYNASA-N}} | ||
{{#set: common name=demethylmenaquinol-7}} | {{#set: common name=demethylmenaquinol-7}} | ||
− | |||
{{#set: common name=DMKH2-7}} | {{#set: common name=DMKH2-7}} | ||
{{#set: consumed by=RXN-9191}} | {{#set: consumed by=RXN-9191}} |
Latest revision as of 16:56, 9 January 2019
Contents
Metabolite CPD-12117
- smiles:
- CC(=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC1(C=C(O)C2(C=CC=CC(C(O)=1)=2)))C
- molecular weight:
- 636.999
- inchi key:
- InChIKey=UFZDIMBXTVRBDS-SSQLMYNASA-N
- common name:
- demethylmenaquinol-7
- Synonym(s):
- DMKH2-7
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links