Difference between revisions of "GLX-tRNAs"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=1-CHLORO-24-DINITROBENZENE 1-CHLORO-24-DINITROBENZENE] == * smiles: ** C1(C=C(Cl)C(=CC=1[N+]([O...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLX-tRNAs GLX-tRNAs] == * common name: ** a tRNAGlx * Synonym(s): == Reaction(s) known to cons...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=1-CHLORO-24-DINITROBENZENE 1-CHLORO-24-DINITROBENZENE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLX-tRNAs GLX-tRNAs] ==
* smiles:
+
** C1(C=C(Cl)C(=CC=1[N+]([O-])=O)[N+]([O-])=O)
+
* inchi key:
+
** InChIKey=VYZAHLCBVHPDDF-UHFFFAOYSA-N
+
 
* common name:
 
* common name:
** 1-chloro-2,4-dinitrobenzene
+
** a tRNAGlx
* molecular weight:
+
** 202.554   
+
 
* Synonym(s):
 
* Synonym(s):
** CDNB
 
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[6.1.1.24-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
* [[GST-RXN]]
 
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=a tRNAGlx}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6 6]
+
{{#set: consumed by=6.1.1.24-RXN}}
* CHEMSPIDER:
+
** [http://www.chemspider.com/Chemical-Structure.13868426.html 13868426]
+
* NCI:
+
** [http://cactus.nci.nih.gov/ncidb2.2/?nsc=6292 6292]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=34718 34718]
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C14397 C14397]
+
{{#set: smiles=C1(C=C(Cl)C(=CC=1[N+]([O-])=O)[N+]([O-])=O)}}
+
{{#set: inchi key=InChIKey=VYZAHLCBVHPDDF-UHFFFAOYSA-N}}
+
{{#set: common name=1-chloro-2,4-dinitrobenzene}}
+
{{#set: molecular weight=202.554    }}
+
{{#set: common name=CDNB}}
+
{{#set: consumed or produced by=GST-RXN}}
+

Latest revision as of 15:12, 23 May 2018

Metabolite GLX-tRNAs

  • common name:
    • a tRNAGlx
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links