Difference between revisions of "SQUALENE-MONOOXYGENASE-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7417 CPD-7417] == * smiles: ** C(C2(OC(OC1(C=CC=CC=1C=CC(=O)[O-]))C(C(C2O)O)O))O * inchi ke...")
 
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7417 CPD-7417] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=SQUALENE-MONOOXYGENASE-RXN SQUALENE-MONOOXYGENASE-RXN] ==
−
* smiles:
+
* direction:
−
** C(C2(OC(OC1(C=CC=CC=1C=CC(=O)[O-]))C(C(C2O)O)O))O
+
** LEFT-TO-RIGHT
−
* inchi key:
+
* ec number:
−
** InChIKey=GVRIYIMNJGULCZ-QLFWQTQQSA-M
+
** [http://enzyme.expasy.org/EC/1.14.14.17 EC-1.14.14.17]
−
* common name:
+
−
** cis-coumarinic acid-β-D-glucoside
+
−
* molecular weight:
+
−
** 325.294   
+
 
* Synonym(s):
 
* Synonym(s):
−
** coumarinic acid glucoside
 
−
** coumarinate glucoside
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-8036]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[Red-NADPH-Hemoprotein-Reductases]][c] '''+''' 1 [[SQUALENE]][c] '''+''' 1 [[OXYGEN-MOLECULE]][c] '''=>''' 1 [[Ox-NADPH-Hemoprotein-Reductases]][c] '''+''' 1 [[WATER]][c] '''+''' 1 [[EPOXYSQUALENE]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 a reduced [NADPH-hemoprotein reductase][c] '''+''' 1 squalene[c] '''+''' 1 oxygen[c] '''=>''' 1 an oxidized [NADPH-hemoprotein reductase][c] '''+''' 1 H2O[c] '''+''' 1 (3S)-2,3-epoxy-2,3-dihydrosqualene[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[scaffold20_461442_460650]]
 +
** Source: [[manual-pathmodel_inference]]
 +
* Gene: [[Scaffold90_7511_6165]]
 +
** Source: [[manual-pathmodel_inference]]
 +
* Gene: [[scaffold57_152407_364140]]
 +
** Source: [[manual-pathmodel_inference]]
 +
== Pathways  ==
 +
* [[PWY-6098]], diploterol and cycloartenol biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6098 PWY-6098]
 +
** '''2''' reactions found over '''4''' reactions in the full pathway
 +
* [[PWY-5670]], epoxysqualene biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5670 PWY-5670]
 +
** '''2''' reactions found over '''2''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[manual]]
 +
** Source: [[manual-pathmodel_inference]]
 +
*** Comment: [[tblastn plus rnaseq evidence]]
 
== External links  ==
 
== External links  ==
−
* LIGAND-CPD:
+
* LIGAND-RXN:
−
** [http://www.genome.jp/dbget-bin/www_bget?C05839 C05839]
+
** [http://www.genome.jp/dbget-bin/www_bget?R02873 R02873]
−
* CHEBI:
+
** [http://www.genome.jp/dbget-bin/www_bget?R02874 R02874]
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62223 62223]
+
* UNIPROT:
−
* PUBCHEM:
+
** [http://www.uniprot.org/uniprot/P52020 P52020]
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25796113 25796113]
+
** [http://www.uniprot.org/uniprot/P32476 P32476]
−
* HMDB : HMDB60077
+
** [http://www.uniprot.org/uniprot/Q9T064 Q9T064]
−
{{#set: smiles=C(C2(OC(OC1(C=CC=CC=1C=CC(=O)[O-]))C(C(C2O)O)O))O}}
+
** [http://www.uniprot.org/uniprot/O65829 O65829]
−
{{#set: inchi key=InChIKey=GVRIYIMNJGULCZ-QLFWQTQQSA-M}}
+
** [http://www.uniprot.org/uniprot/O65726 O65726]
−
{{#set: common name=cis-coumarinic acid-β-D-glucoside}}
+
** [http://www.uniprot.org/uniprot/O65727 O65727]
−
{{#set: molecular weight=325.294    }}
+
** [http://www.uniprot.org/uniprot/O65402 O65402]
−
{{#set: common name=coumarinic acid glucoside|coumarinate glucoside}}
+
** [http://www.uniprot.org/uniprot/O65403 O65403]
−
{{#set: consumed by=RXN-8036}}
+
** [http://www.uniprot.org/uniprot/O65404 O65404]
 +
{{#set: direction=LEFT-TO-RIGHT}}
 +
{{#set: ec number=EC-1.14.14.17}}
 +
{{#set: gene associated=scaffold20_461442_460650|Scaffold90_7511_6165|scaffold57_152407_364140}}
 +
{{#set: in pathway=PWY-6098|PWY-5670}}
 +
{{#set: reconstruction category=manual}}
 +
{{#set: reconstruction source=manual-pathmodel_inference}}
 +
{{#set: reconstruction comment=tblastn plus rnaseq evidence}}

Latest revision as of 15:38, 9 January 2019

Reaction SQUALENE-MONOOXYGENASE-RXN

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-6098, diploterol and cycloartenol biosynthesis: PWY-6098
    • 2 reactions found over 4 reactions in the full pathway
  • PWY-5670, epoxysqualene biosynthesis: PWY-5670
    • 2 reactions found over 2 reactions in the full pathway

Reconstruction information

External links




Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=SQUALENE-MONOOXYGENASE-RXN&oldid=20591"