Difference between revisions of "CALVIN-PWY"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GERANYL-PP GERANYL-PP] == * smiles: ** CC(=CCCC(=CCOP([O-])(OP(=O)([O-])[O-])=O)C)C * inchi key...") |
|||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=CALVIN-PWY CALVIN-PWY] == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** Calvin-Benson-Bassham cycle |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1117 TAX-1117] |
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-39119 TAX-39119] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-38254 TAX-38254] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-29197 TAX-29197] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-38410 TAX-38410] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-5747 TAX-5747] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2864 TAX-2864] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-877183 TAX-877183] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2836 TAX-2836] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3027 TAX-3027] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2830 TAX-2830] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2833 TAX-2833] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3041 TAX-3041] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33682 TAX-33682] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2763 TAX-2763] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2870 TAX-2870] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2825 TAX-2825] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090] | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** photosynthetic dark reactions |
− | ** | + | ** photosynthetic CO2 fixation |
− | ** | + | ** reductive pentose phosphate pathway |
− | ** | + | ** Calvin cycle |
− | ** | + | ** carbon fixation |
− | ** | + | ** Calvin-Benson cycle |
− | == Reaction(s) | + | == Reaction(s) found == |
− | * [[ | + | '''13''' reactions found over '''13''' reactions in the full pathway |
− | * [[ | + | * [[1.2.1.13-RXN]] |
− | + | ** 1 associated gene(s): | |
− | + | *** [[CHC_T00009438001_1]] | |
− | * [[ | + | ** 1 reconstruction source(s) associated: |
+ | *** [[orthology-galdieria.sulphuraria]] | ||
+ | * [[1TRANSKETO-RXN]] | ||
+ | ** 2 associated gene(s): | ||
+ | *** [[CHC_T00009390001_1]] | ||
+ | *** [[CHC_T00005040001_1]] | ||
+ | ** 3 reconstruction source(s) associated: | ||
+ | *** [[orthology-galdieria.sulphuraria]] | ||
+ | *** [[orthology-arabidopsis_thaliana]] | ||
+ | *** [[orthology-ectocarpus_siliculosus]] | ||
+ | * [[2TRANSKETO-RXN]] | ||
+ | ** 2 associated gene(s): | ||
+ | *** [[CHC_T00005040001_1]] | ||
+ | *** [[CHC_T00009390001_1]] | ||
+ | ** 3 reconstruction source(s) associated: | ||
+ | *** [[orthology-galdieria.sulphuraria]] | ||
+ | *** [[orthology-arabidopsis_thaliana]] | ||
+ | *** [[orthology-ectocarpus_siliculosus]] | ||
+ | * [[F16ALDOLASE-RXN]] | ||
+ | ** 2 associated gene(s): | ||
+ | *** [[CHC_T00008586001]] | ||
+ | *** [[CHC_T00008586001_1]] | ||
+ | ** 3 reconstruction source(s) associated: | ||
+ | *** [[orthology-galdieria.sulphuraria]] | ||
+ | *** [[annotation-original_genome]] | ||
+ | *** [[orthology-ectocarpus_siliculosus]] | ||
+ | * [[F16BDEPHOS-RXN]] | ||
+ | ** 6 associated gene(s): | ||
+ | *** [[CHC_T00008570001_1]] | ||
+ | *** [[CHC_T00008369001_1]] | ||
+ | *** [[CHC_T00002260001_1]] | ||
+ | *** [[CHC_T00008570001]] | ||
+ | *** [[CHC_T00008537001]] | ||
+ | *** [[CHC_T00008537001_1]] | ||
+ | ** 4 reconstruction source(s) associated: | ||
+ | *** [[orthology-galdieria.sulphuraria]] | ||
+ | *** [[annotation-original_genome]] | ||
+ | *** [[orthology-arabidopsis_thaliana]] | ||
+ | *** [[orthology-ectocarpus_siliculosus]] | ||
+ | * [[PHOSGLYPHOS-RXN]] | ||
+ | ** 3 associated gene(s): | ||
+ | *** [[CHC_T00004105001_1]] | ||
+ | *** [[CHC_T00009179001]] | ||
+ | *** [[CHC_T00009179001_1]] | ||
+ | ** 4 reconstruction source(s) associated: | ||
+ | *** [[orthology-galdieria.sulphuraria]] | ||
+ | *** [[annotation-original_genome]] | ||
+ | *** [[orthology-arabidopsis_thaliana]] | ||
+ | *** [[orthology-ectocarpus_siliculosus]] | ||
+ | * [[PHOSPHORIBULOKINASE-RXN]] | ||
+ | ** 2 associated gene(s): | ||
+ | *** [[CHC_T00008651001_1]] | ||
+ | *** [[CHC_T00008651001]] | ||
+ | ** 4 reconstruction source(s) associated: | ||
+ | *** [[orthology-galdieria.sulphuraria]] | ||
+ | *** [[annotation-original_genome]] | ||
+ | *** [[orthology-arabidopsis_thaliana]] | ||
+ | *** [[orthology-ectocarpus_siliculosus]] | ||
+ | * [[RIB5PISOM-RXN]] | ||
+ | ** 1 associated gene(s): | ||
+ | *** [[CHC_T00009264001_1]] | ||
+ | ** 3 reconstruction source(s) associated: | ||
+ | *** [[orthology-galdieria.sulphuraria]] | ||
+ | *** [[orthology-arabidopsis_thaliana]] | ||
+ | *** [[orthology-ectocarpus_siliculosus]] | ||
+ | * [[RIBULOSE-BISPHOSPHATE-CARBOXYLASE-RXN]] | ||
+ | ** 3 associated gene(s): | ||
+ | *** [[CHC_955]] | ||
+ | *** [[CHC_950]] | ||
+ | *** [[CHC_T00006620001_1]] | ||
+ | ** 3 reconstruction source(s) associated: | ||
+ | *** [[orthology-galdieria.sulphuraria]] | ||
+ | *** [[annotation-original_genome]] | ||
+ | *** [[orthology-ectocarpus_siliculosus]] | ||
+ | * [[RIBULP3EPIM-RXN]] | ||
+ | ** 3 associated gene(s): | ||
+ | *** [[CHC_T00008270001_1]] | ||
+ | *** [[CHC_T00006121001_1]] | ||
+ | *** [[CHC_T00008270001]] | ||
+ | ** 4 reconstruction source(s) associated: | ||
+ | *** [[orthology-galdieria.sulphuraria]] | ||
+ | *** [[annotation-original_genome]] | ||
+ | *** [[orthology-arabidopsis_thaliana]] | ||
+ | *** [[orthology-ectocarpus_siliculosus]] | ||
+ | * [[SEDOBISALDOL-RXN]] | ||
+ | ** 1 associated gene(s): | ||
+ | *** [[CHC_T00008586001_1]] | ||
+ | ** 2 reconstruction source(s) associated: | ||
+ | *** [[orthology-arabidopsis_thaliana]] | ||
+ | *** [[orthology-ectocarpus_siliculosus]] | ||
+ | * [[SEDOHEPTULOSE-BISPHOSPHATASE-RXN]] | ||
+ | ** 4 associated gene(s): | ||
+ | *** [[CHC_T00008537001_1]] | ||
+ | *** [[CHC_T00008570001_1]] | ||
+ | *** [[CHC_T00008369001]] | ||
+ | *** [[CHC_T00008369001_1]] | ||
+ | ** 4 reconstruction source(s) associated: | ||
+ | *** [[orthology-galdieria.sulphuraria]] | ||
+ | *** [[annotation-original_genome]] | ||
+ | *** [[orthology-arabidopsis_thaliana]] | ||
+ | *** [[orthology-ectocarpus_siliculosus]] | ||
+ | * [[TRIOSEPISOMERIZATION-RXN]] | ||
+ | ** 5 associated gene(s): | ||
+ | *** [[CHC_T00009126001_1]] | ||
+ | *** [[CHC_T00009523001_1]] | ||
+ | *** [[CHC_T00009126001]] | ||
+ | *** [[CHC_T00009545001]] | ||
+ | *** [[CHC_T00009545001_1]] | ||
+ | ** 4 reconstruction source(s) associated: | ||
+ | *** [[orthology-galdieria.sulphuraria]] | ||
+ | *** [[annotation-original_genome]] | ||
+ | *** [[orthology-arabidopsis_thaliana]] | ||
+ | *** [[orthology-ectocarpus_siliculosus]] | ||
+ | == Reaction(s) not found == | ||
== External links == | == External links == | ||
− | * | + | * PLANTCYC : CALVIN-PWY |
− | * | + | * ARACYC: |
− | ** [http:// | + | ** [http://metacyc.org/ARA/NEW-IMAGE?object=CALVIN-PWY CALVIN-PWY] |
− | + | {{#set: common name=Calvin-Benson-Bassham cycle}} | |
− | + | {{#set: taxonomic range=TAX-1117}} | |
− | + | {{#set: taxonomic range=TAX-39119}} | |
− | + | {{#set: taxonomic range=TAX-38254}} | |
− | + | {{#set: taxonomic range=TAX-29197}} | |
− | + | {{#set: taxonomic range=TAX-38410}} | |
− | + | {{#set: taxonomic range=TAX-5747}} | |
− | + | {{#set: taxonomic range=TAX-2864}} | |
− | + | {{#set: taxonomic range=TAX-877183}} | |
− | {{#set: | + | {{#set: taxonomic range=TAX-2836}} |
− | {{#set: | + | {{#set: taxonomic range=TAX-3027}} |
− | {{#set: | + | {{#set: taxonomic range=TAX-2830}} |
− | {{#set: | + | {{#set: taxonomic range=TAX-2833}} |
− | {{#set: common name= | + | {{#set: taxonomic range=TAX-3041}} |
− | {{#set: | + | {{#set: taxonomic range=TAX-33682}} |
− | {{#set: | + | {{#set: taxonomic range=TAX-2763}} |
+ | {{#set: taxonomic range=TAX-2870}} | ||
+ | {{#set: taxonomic range=TAX-2825}} | ||
+ | {{#set: taxonomic range=TAX-2}} | ||
+ | {{#set: taxonomic range=TAX-33090}} | ||
+ | {{#set: common name=photosynthetic dark reactions|photosynthetic CO2 fixation|reductive pentose phosphate pathway|Calvin cycle|carbon fixation|Calvin-Benson cycle}} | ||
+ | {{#set: reaction found=13}} | ||
+ | {{#set: total reaction=13}} | ||
+ | {{#set: completion rate=100.0}} |
Latest revision as of 15:32, 9 January 2019
Pathway CALVIN-PWY
- common name:
- Calvin-Benson-Bassham cycle
- taxonomic range:
- Synonym(s):
- photosynthetic dark reactions
- photosynthetic CO2 fixation
- reductive pentose phosphate pathway
- Calvin cycle
- carbon fixation
- Calvin-Benson cycle
Reaction(s) found
13 reactions found over 13 reactions in the full pathway
- 1.2.1.13-RXN
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
- 1TRANSKETO-RXN
- 2 associated gene(s):
- 3 reconstruction source(s) associated:
- 2TRANSKETO-RXN
- 2 associated gene(s):
- 3 reconstruction source(s) associated:
- F16ALDOLASE-RXN
- 2 associated gene(s):
- 3 reconstruction source(s) associated:
- F16BDEPHOS-RXN
- 6 associated gene(s):
- 4 reconstruction source(s) associated:
- PHOSGLYPHOS-RXN
- 3 associated gene(s):
- 4 reconstruction source(s) associated:
- PHOSPHORIBULOKINASE-RXN
- 2 associated gene(s):
- 4 reconstruction source(s) associated:
- RIB5PISOM-RXN
- 1 associated gene(s):
- 3 reconstruction source(s) associated:
- RIBULOSE-BISPHOSPHATE-CARBOXYLASE-RXN
- 3 associated gene(s):
- 3 reconstruction source(s) associated:
- RIBULP3EPIM-RXN
- 3 associated gene(s):
- 4 reconstruction source(s) associated:
- SEDOBISALDOL-RXN
- 1 associated gene(s):
- 2 reconstruction source(s) associated:
- SEDOHEPTULOSE-BISPHOSPHATASE-RXN
- 4 associated gene(s):
- 4 reconstruction source(s) associated:
- TRIOSEPISOMERIZATION-RXN
- 5 associated gene(s):
- 4 reconstruction source(s) associated:
Reaction(s) not found
External links
- PLANTCYC : CALVIN-PWY
- ARACYC: