Difference between revisions of "CPD0-2500"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18350 CPD-18350] == * smiles: ** CCCCCCCCCCCCCCCC(OCC(OC(=O)CCCCCCCC=CCCCCCC)COP([O-])(=O)[...") |
|||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2500 CPD0-2500] == |
* smiles: | * smiles: | ||
− | ** | + | ** C(O)C2(C(O)C(O)C(O)C(OC1(C=CC(=CC=1)[N+]([O-])=O))O2) |
+ | * molecular weight: | ||
+ | ** 301.252 | ||
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=IFBHRQDFSNCLOZ-IIRVCBMXSA-N |
* common name: | * common name: | ||
− | ** | + | ** p-nitrophenyl-α-D-galactopyranoside |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** 4-nitrophenyl-α-D-galactopyranoside |
− | ** | + | ** 4-nitrophenyl-α-D-galactoside |
+ | ** p-nitrophenyl-α-D-galactoside | ||
+ | ** pNPαGal | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[RXN-17830]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=546840 546840] | ||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=82000 82000] |
− | {{#set: smiles= | + | {{#set: smiles=C(O)C2(C(O)C(O)C(O)C(OC1(C=CC(=CC=1)[N+]([O-])=O))O2)}} |
− | {{#set: inchi key=InChIKey= | + | {{#set: molecular weight=301.252 }} |
− | {{#set: common name= | + | {{#set: inchi key=InChIKey=IFBHRQDFSNCLOZ-IIRVCBMXSA-N}} |
− | + | {{#set: common name=p-nitrophenyl-α-D-galactopyranoside}} | |
− | {{#set: common name= | + | {{#set: common name=4-nitrophenyl-α-D-galactopyranoside|4-nitrophenyl-α-D-galactoside|p-nitrophenyl-α-D-galactoside|pNPαGal}} |
− | {{#set: | + | {{#set: consumed by=RXN-17830}} |
Latest revision as of 15:41, 9 January 2019
Contents
Metabolite CPD0-2500
- smiles:
- C(O)C2(C(O)C(O)C(O)C(OC1(C=CC(=CC=1)[N+]([O-])=O))O2)
- molecular weight:
- 301.252
- inchi key:
- InChIKey=IFBHRQDFSNCLOZ-IIRVCBMXSA-N
- common name:
- p-nitrophenyl-α-D-galactopyranoside
- Synonym(s):
- 4-nitrophenyl-α-D-galactopyranoside
- 4-nitrophenyl-α-D-galactoside
- p-nitrophenyl-α-D-galactoside
- pNPαGal
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(O)C2(C(O)C(O)C(O)C(OC1(C=CC(=CC=1)[N+]([O-])=O))O2)" cannot be used as a page name in this wiki.