Difference between revisions of "CHC T00000667001 1"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3061 CPD-3061] == * smiles: ** C1(C=C(C=CC=1C3(OC2(=CC(=CC=C2C(C3)=O)O)))O) * inchi key: **...") |
|||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene CHC_T00000667001_1 == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[ASNSYNA-RXN]] | |
− | * [[RXN- | + | ** Source: [[orthology-galdieria.sulphuraria]] |
− | == | + | ** Source: [[orthology-ectocarpus_siliculosus]] |
+ | * Reaction: [[ASNSYNB-RXN]] | ||
+ | ** Source: [[orthology-galdieria.sulphuraria]] | ||
+ | ** Source: [[orthology-ectocarpus_siliculosus]] | ||
+ | * Reaction: [[GLUTAMIN-RXN]] | ||
+ | ** Source: [[orthology-galdieria.sulphuraria]] | ||
+ | ** Source: [[orthology-ectocarpus_siliculosus]] | ||
+ | == Pathways associated == | ||
+ | * [[GLUTAMINDEG-PWY]] | ||
+ | * [[CITRULBIO-PWY]] | ||
+ | * [[ASPARAGINESYN-PWY]] | ||
+ | * [[ASPARAGINE-BIOSYNTHESIS]] | ||
== External links == | == External links == | ||
− | + | {{#set: reaction associated=ASNSYNA-RXN|ASNSYNB-RXN|GLUTAMIN-RXN}} | |
− | + | {{#set: pathway associated=GLUTAMINDEG-PWY|CITRULBIO-PWY|ASPARAGINESYN-PWY|ASPARAGINE-BIOSYNTHESIS}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | + |
Latest revision as of 15:32, 9 January 2019
Gene CHC_T00000667001_1
- Synonym(s):
Reactions associated
- Reaction: ASNSYNA-RXN
- Source: orthology-galdieria.sulphuraria
- Source: orthology-ectocarpus_siliculosus
- Reaction: ASNSYNB-RXN
- Source: orthology-galdieria.sulphuraria
- Source: orthology-ectocarpus_siliculosus
- Reaction: GLUTAMIN-RXN
- Source: orthology-galdieria.sulphuraria
- Source: orthology-ectocarpus_siliculosus