Difference between revisions of "Red-Glutaredoxins"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13755 CPD-13755] == * smiles: ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CCC1(C(O)CCC2(C)(C(=O)CC[C...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Red-Glutaredoxins Red-Glutaredoxins] == * common name: ** a reduced glutaredoxin * Synonym(s):...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13755 CPD-13755] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Red-Glutaredoxins Red-Glutaredoxins] ==
* smiles:
+
** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CCC1(C(O)CCC2(C)(C(=O)CC[CH]12)))COP(=O)(OP(=O)(OCC3(C(OP([O-])(=O)[O-])C(O)C(O3)N5(C4(=C(C(N)=NC=N4)N=C5))))[O-])[O-]
+
* inchi key:
+
** InChIKey=AKNIQSRWPADUMX-ODLRQIBISA-J
+
 
* common name:
 
* common name:
** 5-hydroxy-3-[(3aS,4S,5R,7aS)-7a-methyl-1,5-dioxo-octahydro-1H-inden-4-yl]propanoyl-CoA
+
** a reduced glutaredoxin
* molecular weight:
+
** 985.786   
+
 
* Synonym(s):
 
* Synonym(s):
** 5OH-HIP-CoA
+
** glutaredoxin (reduced)
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-982]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-12747]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=a reduced glutaredoxin}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=86290216 86290216]
+
{{#set: common name=glutaredoxin (reduced)}}
* CHEBI:
+
{{#set: consumed by=RXN-982}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=83738 83738]
+
{{#set: smiles=CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CCC1(C(O)CCC2(C)(C(=O)CC[CH]12)))COP(=O)(OP(=O)(OCC3(C(OP([O-])(=O)[O-])C(O)C(O3)N5(C4(=C(C(N)=NC=N4)N=C5))))[O-])[O-]}}
+
{{#set: inchi key=InChIKey=AKNIQSRWPADUMX-ODLRQIBISA-J}}
+
{{#set: common name=5-hydroxy-3-[(3aS,4S,5R,7aS)-7a-methyl-1,5-dioxo-octahydro-1H-inden-4-yl]propanoyl-CoA}}
+
{{#set: molecular weight=985.786    }}
+
{{#set: common name=5OH-HIP-CoA}}
+
{{#set: produced by=RXN-12747}}
+

Latest revision as of 15:13, 23 May 2018

Metabolite Red-Glutaredoxins

  • common name:
    • a reduced glutaredoxin
  • Synonym(s):
    • glutaredoxin (reduced)

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links