Difference between revisions of "CPD-15199"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15199 CPD-15199] == * smiles: ** CC1(OC(C(C1O)O)OP([O-])([O-])=O) * inchi key: ** InChIKey=...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** CC1(OC(C(C1O)O)OP([O-])([O-])=O) | ** CC1(OC(C(C1O)O)OP([O-])([O-])=O) | ||
| + | * molecular weight: | ||
| + | ** 212.096 | ||
* inchi key: | * inchi key: | ||
** InChIKey=XXQFKXPJJNBLSU-TXICZTDVSA-L | ** InChIKey=XXQFKXPJJNBLSU-TXICZTDVSA-L | ||
* common name: | * common name: | ||
** 5-deoxy-α-ribose 1-phosphate | ** 5-deoxy-α-ribose 1-phosphate | ||
| − | |||
| − | |||
* Synonym(s): | * Synonym(s): | ||
| Line 16: | Line 16: | ||
* [[RXN-14304]] | * [[RXN-14304]] | ||
== External links == | == External links == | ||
| − | |||
| − | |||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58749 58749] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58749 58749] | ||
| + | * PUBCHEM: | ||
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=51351655 51351655] | ||
{{#set: smiles=CC1(OC(C(C1O)O)OP([O-])([O-])=O)}} | {{#set: smiles=CC1(OC(C(C1O)O)OP([O-])([O-])=O)}} | ||
| + | {{#set: molecular weight=212.096 }} | ||
{{#set: inchi key=InChIKey=XXQFKXPJJNBLSU-TXICZTDVSA-L}} | {{#set: inchi key=InChIKey=XXQFKXPJJNBLSU-TXICZTDVSA-L}} | ||
{{#set: common name=5-deoxy-α-ribose 1-phosphate}} | {{#set: common name=5-deoxy-α-ribose 1-phosphate}} | ||
| − | |||
{{#set: reversible reaction associated=RXN-14304}} | {{#set: reversible reaction associated=RXN-14304}} | ||
Latest revision as of 16:20, 9 January 2019
Contents
Metabolite CPD-15199
- smiles:
- CC1(OC(C(C1O)O)OP([O-])([O-])=O)
- molecular weight:
- 212.096
- inchi key:
- InChIKey=XXQFKXPJJNBLSU-TXICZTDVSA-L
- common name:
- 5-deoxy-α-ribose 1-phosphate
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC1(OC(C(C1O)O)OP([O-])([O-])=O)" cannot be used as a page name in this wiki.
