Difference between revisions of "PWY-3341"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=URATE URATE] == * smiles: ** C12(NC(=O)NC=1C(=O)NC(=O)N2) * inchi key: ** InChIKey=LEHOTFFKMJEO...") |
|||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-3341 PWY-3341] == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** L-proline biosynthesis III |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090] |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction(s) found == |
− | * [[ | + | '''5''' reactions found over '''5''' reactions in the full pathway |
− | + | * [[GLUTKIN-RXN]] | |
− | * [[ | + | ** 1 associated gene(s): |
− | + | *** [[CHC_T00008349001_1]] | |
− | * [[ | + | ** 2 reconstruction source(s) associated: |
+ | *** [[orthology-arabidopsis_thaliana]] | ||
+ | *** [[orthology-ectocarpus_siliculosus]] | ||
+ | * [[GLUTSEMIALDEHYDROG-RXN]] | ||
+ | ** 2 associated gene(s): | ||
+ | *** [[CHC_T00008349001_1]] | ||
+ | *** [[CHC_T00008349001]] | ||
+ | ** 4 reconstruction source(s) associated: | ||
+ | *** [[orthology-galdieria.sulphuraria]] | ||
+ | *** [[annotation-original_genome]] | ||
+ | *** [[orthology-arabidopsis_thaliana]] | ||
+ | *** [[orthology-ectocarpus_siliculosus]] | ||
+ | * [[ORNITHINE-GLU-AMINOTRANSFERASE-RXN]] | ||
+ | ** 1 associated gene(s): | ||
+ | *** [[CHC_T00002893001_1]] | ||
+ | ** 2 reconstruction source(s) associated: | ||
+ | *** [[orthology-galdieria.sulphuraria]] | ||
+ | *** [[orthology-ectocarpus_siliculosus]] | ||
+ | * [[PYRROLINECARBREDUCT-RXN]] | ||
+ | ** 1 associated gene(s): | ||
+ | *** [[CHC_T00001376001_1]] | ||
+ | ** 2 reconstruction source(s) associated: | ||
+ | *** [[orthology-galdieria.sulphuraria]] | ||
+ | *** [[orthology-ectocarpus_siliculosus]] | ||
+ | * [[SPONTPRO-RXN]] | ||
+ | ** 0 associated gene: | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[gap-filling-gapfilling_solution_with_meneco_draft_medium]] | ||
+ | == Reaction(s) not found == | ||
== External links == | == External links == | ||
− | * | + | * ARACYC: |
− | + | ** [http://metacyc.org/ARA/NEW-IMAGE?object=PWY-3341 PWY-3341] | |
− | + | {{#set: common name=L-proline biosynthesis III}} | |
− | + | {{#set: taxonomic range=TAX-33090}} | |
− | + | {{#set: reaction found=5}} | |
− | ** [http:// | + | {{#set: total reaction=5}} |
− | + | {{#set: completion rate=100.0}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 16:33, 9 January 2019
Pathway PWY-3341
- common name:
- L-proline biosynthesis III
- taxonomic range:
- Synonym(s):
Reaction(s) found
5 reactions found over 5 reactions in the full pathway
- GLUTKIN-RXN
- 1 associated gene(s):
- 2 reconstruction source(s) associated:
- GLUTSEMIALDEHYDROG-RXN
- 2 associated gene(s):
- 4 reconstruction source(s) associated:
- ORNITHINE-GLU-AMINOTRANSFERASE-RXN
- 1 associated gene(s):
- 2 reconstruction source(s) associated:
- PYRROLINECARBREDUCT-RXN
- 1 associated gene(s):
- 2 reconstruction source(s) associated:
- SPONTPRO-RXN
- 0 associated gene:
- 1 reconstruction source(s) associated:
Reaction(s) not found
External links
- ARACYC: