Difference between revisions of "CPD0-2189"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2189 CPD0-2189] == * smiles: ** C(O)C(O)C([N+])C(=O)[O-] * inchi key: ** InChIKey=JBNUARFQ...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** C(O)C(O)C([N+])C(=O)[O-] | ** C(O)C(O)C([N+])C(=O)[O-] | ||
| + | * molecular weight: | ||
| + | ** 135.119 | ||
* inchi key: | * inchi key: | ||
** InChIKey=JBNUARFQOCGDRK-GBXIJSLDSA-N | ** InChIKey=JBNUARFQOCGDRK-GBXIJSLDSA-N | ||
* common name: | * common name: | ||
** 4-hydroxy-L-threonine | ** 4-hydroxy-L-threonine | ||
| − | |||
| − | |||
* Synonym(s): | * Synonym(s): | ||
** (2S,3S)-2-amino-3,4-dihydroxybutanoic acid | ** (2S,3S)-2-amino-3,4-dihydroxybutanoic acid | ||
| Line 19: | Line 19: | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| + | * BIGG : 4hthr | ||
* CAS : 21768-45-6 | * CAS : 21768-45-6 | ||
| − | |||
| − | |||
| − | |||
| − | |||
* CHEMSPIDER: | * CHEMSPIDER: | ||
** [http://www.chemspider.com/Chemical-Structure.167988.html 167988] | ** [http://www.chemspider.com/Chemical-Structure.167988.html 167988] | ||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=60904 60904] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=60904 60904] | ||
| − | * | + | * LIGAND-CPD: |
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C06056 C06056] | ||
| + | * PUBCHEM: | ||
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=49852420 49852420] | ||
{{#set: smiles=C(O)C(O)C([N+])C(=O)[O-]}} | {{#set: smiles=C(O)C(O)C([N+])C(=O)[O-]}} | ||
| + | {{#set: molecular weight=135.119 }} | ||
{{#set: inchi key=InChIKey=JBNUARFQOCGDRK-GBXIJSLDSA-N}} | {{#set: inchi key=InChIKey=JBNUARFQOCGDRK-GBXIJSLDSA-N}} | ||
{{#set: common name=4-hydroxy-L-threonine}} | {{#set: common name=4-hydroxy-L-threonine}} | ||
| − | |||
{{#set: common name=(2S,3S)-2-amino-3,4-dihydroxybutanoic acid|hydroxythreonine|3-hydroxyhomoserine}} | {{#set: common name=(2S,3S)-2-amino-3,4-dihydroxybutanoic acid|hydroxythreonine|3-hydroxyhomoserine}} | ||
{{#set: produced by=RXN-14125}} | {{#set: produced by=RXN-14125}} | ||
Latest revision as of 16:22, 9 January 2019
Contents
Metabolite CPD0-2189
- smiles:
- C(O)C(O)C([N+])C(=O)[O-]
- molecular weight:
- 135.119
- inchi key:
- InChIKey=JBNUARFQOCGDRK-GBXIJSLDSA-N
- common name:
- 4-hydroxy-L-threonine
- Synonym(s):
- (2S,3S)-2-amino-3,4-dihydroxybutanoic acid
- hydroxythreonine
- 3-hydroxyhomoserine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(O)C(O)C([N+])C(=O)[O-" cannot be used as a page name in this wiki.
