Difference between revisions of "TRNAs"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ARG ARG] == * smiles: ** C(NC(N)=[N+])CCC([N+])C(=O)[O-] * inchi key: ** InChIKey=ODKSFYDXXFIFQ...") |
|||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=tRNAs tRNAs] == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** an uncharged tRNA |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[AMINOCYL-TRNA-HYDROLASE-RXN]] | ||
+ | * [[RXN0-6480]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | |||
− | |||
− | |||
== External links == | == External links == | ||
− | + | {{#set: common name=an uncharged tRNA}} | |
− | + | {{#set: produced by=AMINOCYL-TRNA-HYDROLASE-RXN|RXN0-6480}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | + | ||
− | + | ||
− | + |
Latest revision as of 16:45, 9 January 2019
Contents
Metabolite tRNAs
- common name:
- an uncharged tRNA
- Synonym(s):