Difference between revisions of "RIBITOL"
From metabolic_network
(Created page with "Category:Gene == Gene CHC_T00000718001_1 == * Synonym(s): == Reactions associated == * QUINOPRIBOTRANS-RXN ** pantograph-a.taliana == Pathways associated == *...") |
|||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=RIBITOL RIBITOL] == |
+ | * smiles: | ||
+ | ** C(O)C(O)C(O)C(O)CO | ||
+ | * molecular weight: | ||
+ | ** 152.147 | ||
+ | * inchi key: | ||
+ | ** InChIKey=HEBKCHPVOIAQTA-ZXFHETKHSA-N | ||
+ | * common name: | ||
+ | ** ribitol | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** meso-ribitol | ||
+ | ** adonitol | ||
+ | ** (2R,3s,4S)-pentane-1,2,3,4,5-pentol | ||
+ | ** D-ribitol | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | == | + | * [[RIBITOL-2-DEHYDROGENASE-RXN]] |
− | * [[ | + | |
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=15963 15963] |
+ | * CAS : 488-81-3 | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C00474 C00474] | ||
+ | * METABOLIGHTS : MTBLC15963 | ||
+ | * HMDB : HMDB00508 | ||
+ | {{#set: smiles=C(O)C(O)C(O)C(O)CO}} | ||
+ | {{#set: molecular weight=152.147 }} | ||
+ | {{#set: inchi key=InChIKey=HEBKCHPVOIAQTA-ZXFHETKHSA-N}} | ||
+ | {{#set: common name=ribitol}} | ||
+ | {{#set: common name=meso-ribitol|adonitol|(2R,3s,4S)-pentane-1,2,3,4,5-pentol|D-ribitol}} | ||
+ | {{#set: reversible reaction associated=RIBITOL-2-DEHYDROGENASE-RXN}} |
Latest revision as of 15:45, 9 January 2019
Contents
Metabolite RIBITOL
- smiles:
- C(O)C(O)C(O)C(O)CO
- molecular weight:
- 152.147
- inchi key:
- InChIKey=HEBKCHPVOIAQTA-ZXFHETKHSA-N
- common name:
- ribitol
- Synonym(s):
- meso-ribitol
- adonitol
- (2R,3s,4S)-pentane-1,2,3,4,5-pentol
- D-ribitol
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links