Difference between revisions of "PWY-5665"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3188 CPD-3188] == * smiles: ** C1(=O)(CC[CH](N(CO)1)C2(C=NC=CC=2)) * inchi key: ** InChIKey...") |
|||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5665 PWY-5665] == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** vanillin biosynthesis I |
| − | * | + | * taxonomic range: |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-73496 TAX-73496] |
* Synonym(s): | * Synonym(s): | ||
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | + | '''1''' reactions found over '''3''' reactions in the full pathway | |
| − | * [[ | + | * [[RXN-8872]] |
| − | == Reaction(s) | + | ** 3 associated gene(s): |
| + | *** [[CHC_T00008302001_1]] | ||
| + | *** [[CHC_T00009144001_1]] | ||
| + | *** [[CHC_T00008799001_1]] | ||
| + | ** 1 reconstruction source(s) associated: | ||
| + | *** [[orthology-galdieria.sulphuraria]] | ||
| + | == Reaction(s) not found == | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-8871 RXN-8871] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-8873 RXN-8873] | ||
== External links == | == External links == | ||
| − | + | {{#set: common name=vanillin biosynthesis I}} | |
| − | + | {{#set: taxonomic range=TAX-73496}} | |
| − | + | {{#set: reaction found=1}} | |
| − | {{#set: | + | {{#set: total reaction=3}} |
| − | {{#set: | + | {{#set: completion rate=33.0}} |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 15:35, 9 January 2019
Pathway PWY-5665
- common name:
- vanillin biosynthesis I
- taxonomic range:
- Synonym(s):
Reaction(s) found
1 reactions found over 3 reactions in the full pathway
- RXN-8872
- 3 associated gene(s):
- 1 reconstruction source(s) associated:
