Difference between revisions of "RXN-11244"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HYDROXYMETHYLBILANE HYDROXYMETHYLBILANE] == * smiles: ** C(O)C1(NC(=C(CCC(=O)[O-])C(CC(=O)[O-])...")
 
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HYDROXYMETHYLBILANE HYDROXYMETHYLBILANE] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11244 RXN-11244] ==
−
* smiles:
+
* direction:
−
** C(O)C1(NC(=C(CCC(=O)[O-])C(CC(=O)[O-])=1)CC2(=C(CC(=O)[O-])C(CCC(=O)[O-])=C(N2)CC4(=C(CC([O-])=O)C(CCC(=O)[O-])=C(CC3(=C(CC([O-])=O)C(CCC(=O)[O-])=CN3))N4)))
+
** LEFT-TO-RIGHT
−
* inchi key:
+
* ec number:
−
** InChIKey=WDFJYRZCZIUBPR-UHFFFAOYSA-F
+
** [http://enzyme.expasy.org/EC/4.2.1.17 EC-4.2.1.17]
−
* common name:
+
−
** preuroporphyrinogen
+
−
* molecular weight:
+
−
** 846.757   
+
 
* Synonym(s):
 
* Synonym(s):
−
** hydroxymethylbilane
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[UROGENIIISYN-RXN]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[WATER]][c] '''+''' 1 [[P-COUMAROYL-COA]][c] '''=>''' 1 [[CPD-12199]][c]
−
* [[OHMETHYLBILANESYN-RXN]]
+
* With common name(s):
−
== Reaction(s) of unknown directionality ==
+
** 1 H2O[c] '''+''' 1 4-coumaroyl-CoA[c] '''=>''' 1 3S-(4-hydroxyphenyl)-3-hydroxy-propanoyl-CoA[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[CHC_T00009190001_1]]
 +
** Source: [[orthology-ectocarpus_siliculosus]]
 +
* Gene: [[CHC_T00009349001_1]]
 +
** Source: [[orthology-galdieria.sulphuraria]]
 +
** Source: [[orthology-ectocarpus_siliculosus]]
 +
* Gene: [[CHC_T00009110001_1]]
 +
** Source: [[orthology-galdieria.sulphuraria]]
 +
** Source: [[orthology-ectocarpus_siliculosus]]
 +
* Gene: [[CHC_T00009422001_1]]
 +
** Source: [[orthology-galdieria.sulphuraria]]
 +
== Pathways  ==
 +
* [[PWY-7046]], 4-coumarate degradation (anaerobic): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7046 PWY-7046]
 +
** '''2''' reactions found over '''6''' reactions in the full pathway
 +
* [[PWY-6435]], 4-hydroxybenzoate biosynthesis V: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6435 PWY-6435]
 +
** '''4''' reactions found over '''5''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-galdieria.sulphuraria]]
 +
*** Tool: [[pantograph]]
 +
** Source: [[orthology-ectocarpus_siliculosus]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* CAS : 73023-76-4
+
{{#set: direction=LEFT-TO-RIGHT}}
−
* METABOLIGHTS : MTBLC57845
+
{{#set: ec number=EC-4.2.1.17}}
−
* PUBCHEM:
+
{{#set: gene associated=CHC_T00009190001_1|CHC_T00009349001_1|CHC_T00009110001_1|CHC_T00009422001_1}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46931104 46931104]
+
{{#set: in pathway=PWY-7046|PWY-6435}}
−
* HMDB : HMDB01137
+
{{#set: reconstruction category=orthology}}
−
* LIGAND-CPD:
+
{{#set: reconstruction source=orthology-galdieria.sulphuraria|orthology-ectocarpus_siliculosus}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C01024 C01024]
+
{{#set: reconstruction tool=pantograph}}
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57845 57845]
+
−
* BIGG : hmbil
+
−
{{#set: smiles=C(O)C1(NC(=C(CCC(=O)[O-])C(CC(=O)[O-])=1)CC2(=C(CC(=O)[O-])C(CCC(=O)[O-])=C(N2)CC4(=C(CC([O-])=O)C(CCC(=O)[O-])=C(CC3(=C(CC([O-])=O)C(CCC(=O)[O-])=CN3))N4)))}}
+
−
{{#set: inchi key=InChIKey=WDFJYRZCZIUBPR-UHFFFAOYSA-F}}
+
−
{{#set: common name=preuroporphyrinogen}}
+
−
{{#set: molecular weight=846.757    }}
+
−
{{#set: common name=hydroxymethylbilane}}
+
−
{{#set: consumed by=UROGENIIISYN-RXN}}
+
−
{{#set: produced by=OHMETHYLBILANESYN-RXN}}
+

Latest revision as of 15:42, 9 January 2019

Reaction RXN-11244

  • direction:
    • LEFT-TO-RIGHT
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 H2O[c] + 1 4-coumaroyl-CoA[c] => 1 3S-(4-hydroxyphenyl)-3-hydroxy-propanoyl-CoA[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-7046, 4-coumarate degradation (anaerobic): PWY-7046
    • 2 reactions found over 6 reactions in the full pathway
  • PWY-6435, 4-hydroxybenzoate biosynthesis V: PWY-6435
    • 4 reactions found over 5 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=RXN-11244&oldid=20689"