Difference between revisions of "CPD-15172"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12871 RXN-12871] == * direction: ** LEFT-TO-RIGHT * Synonym(s): == Reaction Formula == * With...") |
|||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15172 CPD-15172] == |
− | * | + | * smiles: |
− | ** | + | ** C1(C=CC(=CC=1)C2(=CC(=O)C3(C(O2)=CC(=O)C(=O)C(O)=3))) |
+ | * molecular weight: | ||
+ | ** 268.225 | ||
+ | * inchi key: | ||
+ | ** InChIKey=LSQWCIYRGVWPFX-UHFFFAOYSA-N | ||
+ | * common name: | ||
+ | ** 6,7-dehydrobaicalein | ||
* Synonym(s): | * Synonym(s): | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[RXN-14240]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | * [[ | + | |
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=86200952 86200952] |
− | {{#set: | + | {{#set: smiles=C1(C=CC(=CC=1)C2(=CC(=O)C3(C(O2)=CC(=O)C(=O)C(O)=3)))}} |
− | {{#set: | + | {{#set: molecular weight=268.225 }} |
− | {{#set: | + | {{#set: inchi key=InChIKey=LSQWCIYRGVWPFX-UHFFFAOYSA-N}} |
+ | {{#set: common name=6,7-dehydrobaicalein}} | ||
+ | {{#set: produced by=RXN-14240}} |
Latest revision as of 16:46, 9 January 2019
Contents
Metabolite CPD-15172
- smiles:
- C1(C=CC(=CC=1)C2(=CC(=O)C3(C(O2)=CC(=O)C(=O)C(O)=3)))
- molecular weight:
- 268.225
- inchi key:
- InChIKey=LSQWCIYRGVWPFX-UHFFFAOYSA-N
- common name:
- 6,7-dehydrobaicalein
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM: