Difference between revisions of "3.4.13.9-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-HISTIDINOL-P L-HISTIDINOL-P] == * smiles: ** C1(NC=NC=1CC(COP([O-])(=O)[O-])[N+]) * inchi key...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=3.4.13.9-RXN 3.4.13.9-RXN] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.o...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=3.4.13.9-RXN 3.4.13.9-RXN] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/3.4.13.9 EC-3.4.13.9] |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | + | ** 1 [[WATER]][c] '''+''' 1 [[Dipeptides-With-Proline-Carboxy]][c] '''=>''' 1 [[Amino-Acids-20]][c] '''+''' 1 [[PRO]][c] | |
− | + | * With common name(s): | |
− | * [[ | + | ** 1 H2O[c] '''+''' 1 a dipeptide with proline at the C-terminal[c] '''=>''' 1 a proteinogenic amino acid[c] '''+''' 1 L-proline[c] |
− | == | + | |
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[CHC_T00005156001_1]] | ||
+ | ** Source: [[orthology-galdieria.sulphuraria]] | ||
+ | * Gene: [[CHC_T00001494001_1]] | ||
+ | ** Source: [[orthology-galdieria.sulphuraria]] | ||
+ | == Pathways == | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-galdieria.sulphuraria]] | ||
+ | *** Tool: [[pantograph]] | ||
== External links == | == External links == | ||
− | * | + | * UNIPROT: |
− | * | + | ** [http://www.uniprot.org/uniprot/Q9CF32 Q9CF32] |
− | ** [http:// | + | ** [http://www.uniprot.org/uniprot/O67493 O67493] |
− | * | + | ** [http://www.uniprot.org/uniprot/O27062 O27062] |
− | * | + | ** [http://www.uniprot.org/uniprot/O25681 O25681] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/Q58216 Q58216] |
− | * | + | ** [http://www.uniprot.org/uniprot/P21165 P21165] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/P46545 P46545] |
− | * | + | ** [http://www.uniprot.org/uniprot/P75313 P75313] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P81535 P81535] |
− | {{#set: | + | {{#set: direction=LEFT-TO-RIGHT}} |
− | {{#set: | + | {{#set: ec number=EC-3.4.13.9}} |
− | {{#set: | + | {{#set: gene associated=CHC_T00005156001_1|CHC_T00001494001_1}} |
− | {{#set: | + | {{#set: in pathway=}} |
− | {{#set: | + | {{#set: reconstruction category=orthology}} |
− | {{#set: | + | {{#set: reconstruction source=orthology-galdieria.sulphuraria}} |
+ | {{#set: reconstruction tool=pantograph}} |
Latest revision as of 16:15, 23 May 2018
Contents
Reaction 3.4.13.9-RXN
- direction:
- LEFT-TO-RIGHT
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 WATER[c] + 1 Dipeptides-With-Proline-Carboxy[c] => 1 Amino-Acids-20[c] + 1 PRO[c]
- With common name(s):
- 1 H2O[c] + 1 a dipeptide with proline at the C-terminal[c] => 1 a proteinogenic amino acid[c] + 1 L-proline[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: CHC_T00005156001_1
- Source: orthology-galdieria.sulphuraria
- Gene: CHC_T00001494001_1
- Source: orthology-galdieria.sulphuraria
Pathways
Reconstruction information
- Category: orthology
- Source: orthology-galdieria.sulphuraria
- Tool: pantograph
- Source: orthology-galdieria.sulphuraria
External links