Difference between revisions of "CPD-4184"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4184 CPD-4184] == * smiles: ** CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C)C(O)...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C)C(O)CC3)))CC4)))C | ** CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C)C(O)CC3)))CC4)))C | ||
| + | * molecular weight: | ||
| + | ** 400.687 | ||
* inchi key: | * inchi key: | ||
** InChIKey=SCEZIHJVTBQOLS-YIJYGBTNSA-N | ** InChIKey=SCEZIHJVTBQOLS-YIJYGBTNSA-N | ||
* common name: | * common name: | ||
** 4α-methyl-cholesta-8-enol | ** 4α-methyl-cholesta-8-enol | ||
| − | |||
| − | |||
* Synonym(s): | * Synonym(s): | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
* [[RXN66-20]] | * [[RXN66-20]] | ||
| + | * [[RXN-13710]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | |||
| − | |||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=28432 28432] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=28432 28432] | ||
| + | * PUBCHEM: | ||
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6452640 6452640] | ||
* LIGAND-CPD: | * LIGAND-CPD: | ||
** [http://www.genome.jp/dbget-bin/www_bget?C05110 C05110] | ** [http://www.genome.jp/dbget-bin/www_bget?C05110 C05110] | ||
{{#set: smiles=CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C)C(O)CC3)))CC4)))C}} | {{#set: smiles=CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C)C(O)CC3)))CC4)))C}} | ||
| + | {{#set: molecular weight=400.687 }} | ||
{{#set: inchi key=InChIKey=SCEZIHJVTBQOLS-YIJYGBTNSA-N}} | {{#set: inchi key=InChIKey=SCEZIHJVTBQOLS-YIJYGBTNSA-N}} | ||
{{#set: common name=4α-methyl-cholesta-8-enol}} | {{#set: common name=4α-methyl-cholesta-8-enol}} | ||
| − | + | {{#set: consumed by=RXN66-20|RXN-13710}} | |
| − | {{#set: consumed by=RXN-13710 | + | |
Latest revision as of 16:52, 9 January 2019
Contents
Metabolite CPD-4184
- smiles:
- CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C)C(O)CC3)))CC4)))C
- molecular weight:
- 400.687
- inchi key:
- InChIKey=SCEZIHJVTBQOLS-YIJYGBTNSA-N
- common name:
- 4α-methyl-cholesta-8-enol
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C)C(O)CC3)))CC4)))C" cannot be used as a page name in this wiki.
