Difference between revisions of "CPD-2751"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-2751 CPD-2751] == * smiles: ** C1(=O)(CCC(O)(N(C)1)C2(=CN=CC=C2)) * inchi key: ** InChIKey=...") |
|||
Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** C1(=O)(CCC(O)(N(C)1)C2(=CN=CC=C2)) | ** C1(=O)(CCC(O)(N(C)1)C2(=CN=CC=C2)) | ||
+ | * molecular weight: | ||
+ | ** 192.217 | ||
* inchi key: | * inchi key: | ||
** InChIKey=BBNHNZGTKSWIHD-SNVBAGLBSA-N | ** InChIKey=BBNHNZGTKSWIHD-SNVBAGLBSA-N | ||
* common name: | * common name: | ||
** 5'-hydroxycotinine | ** 5'-hydroxycotinine | ||
− | |||
− | |||
* Synonym(s): | * Synonym(s): | ||
** allohydroxycotinine | ** allohydroxycotinine | ||
Line 23: | Line 23: | ||
* HMDB : HMDB01427 | * HMDB : HMDB01427 | ||
{{#set: smiles=C1(=O)(CCC(O)(N(C)1)C2(=CN=CC=C2))}} | {{#set: smiles=C1(=O)(CCC(O)(N(C)1)C2(=CN=CC=C2))}} | ||
+ | {{#set: molecular weight=192.217 }} | ||
{{#set: inchi key=InChIKey=BBNHNZGTKSWIHD-SNVBAGLBSA-N}} | {{#set: inchi key=InChIKey=BBNHNZGTKSWIHD-SNVBAGLBSA-N}} | ||
{{#set: common name=5'-hydroxycotinine}} | {{#set: common name=5'-hydroxycotinine}} | ||
− | |||
{{#set: common name=allohydroxycotinine}} | {{#set: common name=allohydroxycotinine}} | ||
{{#set: produced by=RXN66-163}} | {{#set: produced by=RXN66-163}} |
Latest revision as of 17:55, 9 January 2019
Contents
Metabolite CPD-2751
- smiles:
- C1(=O)(CCC(O)(N(C)1)C2(=CN=CC=C2))
- molecular weight:
- 192.217
- inchi key:
- InChIKey=BBNHNZGTKSWIHD-SNVBAGLBSA-N
- common name:
- 5'-hydroxycotinine
- Synonym(s):
- allohydroxycotinine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links