Difference between revisions of "RXN-10954"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DUDP DUDP] == * smiles: ** C(OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(CC(O)1)N2(C=CC(=O)NC(=O)2)) * i...") |
|||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10954 RXN-10954] == |
− | + | * direction: | |
− | + | ** LEFT-TO-RIGHT | |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/3.1.3.25 EC-3.1.3.25] |
− | * | + | |
− | ** | + | |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | * [[ | + | ** 1 [[WATER]][c] '''+''' 1 [[CPD-6702]][c] '''=>''' 1 [[MYO-INOSITOL]][c] '''+''' 1 [[Pi]][c] |
− | == | + | * With common name(s): |
− | * [[ | + | ** 1 H2O[c] '''+''' 1 1D-myo-inositol 6-monophosphate[c] '''=>''' 1 myo-inositol[c] '''+''' 1 phosphate[c] |
− | * [[ | + | |
− | * [[ | + | == Genes associated with this reaction == |
− | == | + | Genes have been associated with this reaction based on different elements listed below. |
+ | * Gene: [[CHC_T00002260001_1]] | ||
+ | ** Source: [[orthology-galdieria.sulphuraria]] | ||
+ | * Gene: [[CHC_T00007726001_1]] | ||
+ | ** Source: [[orthology-galdieria.sulphuraria]] | ||
+ | ** Source: [[orthology-ectocarpus_siliculosus]] | ||
+ | * Gene: [[CHC_T00001291001_1]] | ||
+ | ** Source: [[orthology-galdieria.sulphuraria]] | ||
+ | ** Source: [[orthology-ectocarpus_siliculosus]] | ||
+ | == Pathways == | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-galdieria.sulphuraria]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | ** Source: [[orthology-ectocarpus_siliculosus]] | ||
+ | *** Tool: [[pantograph]] | ||
== External links == | == External links == | ||
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | + | {{#set: ec number=EC-3.1.3.25}} | |
− | + | {{#set: gene associated=CHC_T00002260001_1|CHC_T00007726001_1|CHC_T00001291001_1}} | |
− | + | {{#set: in pathway=}} | |
− | + | {{#set: reconstruction category=orthology}} | |
− | + | {{#set: reconstruction source=orthology-galdieria.sulphuraria|orthology-ectocarpus_siliculosus}} | |
− | + | {{#set: reconstruction tool=pantograph}} | |
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 15:44, 9 January 2019
Contents
Reaction RXN-10954
- direction:
- LEFT-TO-RIGHT
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 WATER[c] + 1 CPD-6702[c] => 1 MYO-INOSITOL[c] + 1 Pi[c]
- With common name(s):
- 1 H2O[c] + 1 1D-myo-inositol 6-monophosphate[c] => 1 myo-inositol[c] + 1 phosphate[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: CHC_T00002260001_1
- Source: orthology-galdieria.sulphuraria
- Gene: CHC_T00007726001_1
- Source: orthology-galdieria.sulphuraria
- Source: orthology-ectocarpus_siliculosus
- Gene: CHC_T00001291001_1
- Source: orthology-galdieria.sulphuraria
- Source: orthology-ectocarpus_siliculosus
Pathways
Reconstruction information
- Category: orthology
- Source: orthology-galdieria.sulphuraria
- Tool: pantograph
- Source: orthology-ectocarpus_siliculosus
- Tool: pantograph
- Source: orthology-galdieria.sulphuraria