Difference between revisions of "RXN-10954"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DUDP DUDP] == * smiles: ** C(OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(CC(O)1)N2(C=CC(=O)NC(=O)2)) * i...")
 
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DUDP DUDP] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10954 RXN-10954] ==
−
* smiles:
+
* direction:
−
** C(OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(CC(O)1)N2(C=CC(=O)NC(=O)2))
+
** LEFT-TO-RIGHT
−
* inchi key:
+
* ec number:
−
** InChIKey=QHWZTVCCBMIIKE-SHYZEUOFSA-K
+
** [http://enzyme.expasy.org/EC/3.1.3.25 EC-3.1.3.25]
−
* common name:
+
−
** dUDP
+
−
* molecular weight:
+
−
** 385.14   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 2'-deoxyuridine-5'-diphosphate
 
−
** deoxyuridine-diphosphate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-14220]]
+
* With identifiers:
−
* [[DUDPKIN-RXN]]
+
** 1 [[WATER]][c] '''+''' 1 [[CPD-6702]][c] '''=>''' 1 [[MYO-INOSITOL]][c] '''+''' 1 [[Pi]][c]
−
== Reaction(s) known to produce the compound ==
+
* With common name(s):
−
* [[RXN0-722]]
+
** 1 H2O[c] '''+''' 1 1D-myo-inositol 6-monophosphate[c] '''=>''' 1 myo-inositol[c] '''+''' 1 phosphate[c]
−
* [[UDPREDUCT-RXN]]
+
 
−
* [[RXN-14219]]
+
== Genes associated with this reaction  ==
−
== Reaction(s) of unknown directionality ==
+
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[CHC_T00002260001_1]]
 +
** Source: [[orthology-galdieria.sulphuraria]]
 +
* Gene: [[CHC_T00007726001_1]]
 +
** Source: [[orthology-galdieria.sulphuraria]]
 +
** Source: [[orthology-ectocarpus_siliculosus]]
 +
* Gene: [[CHC_T00001291001_1]]
 +
** Source: [[orthology-galdieria.sulphuraria]]
 +
** Source: [[orthology-ectocarpus_siliculosus]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-galdieria.sulphuraria]]
 +
*** Tool: [[pantograph]]
 +
** Source: [[orthology-ectocarpus_siliculosus]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* BIGG : dudp
+
{{#set: direction=LEFT-TO-RIGHT}}
−
* PUBCHEM:
+
{{#set: ec number=EC-3.1.3.25}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25246037 25246037]
+
{{#set: gene associated=CHC_T00002260001_1|CHC_T00007726001_1|CHC_T00001291001_1}}
−
* HMDB : HMDB01000
+
{{#set: in pathway=}}
−
* LIGAND-CPD:
+
{{#set: reconstruction category=orthology}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C01346 C01346]
+
{{#set: reconstruction source=orthology-galdieria.sulphuraria|orthology-ectocarpus_siliculosus}}
−
* CHEBI:
+
{{#set: reconstruction tool=pantograph}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=60471 60471]
+
−
* METABOLIGHTS : MTBLC60471
+
−
{{#set: smiles=C(OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(CC(O)1)N2(C=CC(=O)NC(=O)2))}}
+
−
{{#set: inchi key=InChIKey=QHWZTVCCBMIIKE-SHYZEUOFSA-K}}
+
−
{{#set: common name=dUDP}}
+
−
{{#set: molecular weight=385.14    }}
+
−
{{#set: common name=2'-deoxyuridine-5'-diphosphate|deoxyuridine-diphosphate}}
+
−
{{#set: consumed by=RXN-14220|DUDPKIN-RXN}}
+
−
{{#set: produced by=RXN0-722|UDPREDUCT-RXN|RXN-14219}}
+

Latest revision as of 15:44, 9 January 2019

Reaction RXN-10954

  • direction:
    • LEFT-TO-RIGHT
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 H2O[c] + 1 1D-myo-inositol 6-monophosphate[c] => 1 myo-inositol[c] + 1 phosphate[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=RXN-10954&oldid=20730"