Difference between revisions of "N-ACETYL-D-GLUCOSAMINE-1-P"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-ACETYL-D-GLUCOSAMINE-1-P N-ACETYL-D-GLUCOSAMINE-1-P] == * smiles: ** CC(=O)NC1(C(O)C(O)C(CO)O...") |
|||
Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** CC(=O)NC1(C(O)C(O)C(CO)OC(OP(=O)([O-])[O-])1) | ** CC(=O)NC1(C(O)C(O)C(CO)OC(OP(=O)([O-])[O-])1) | ||
+ | * molecular weight: | ||
+ | ** 299.174 | ||
* inchi key: | * inchi key: | ||
** InChIKey=FZLJPEPAYPUMMR-FMDGEEDCSA-L | ** InChIKey=FZLJPEPAYPUMMR-FMDGEEDCSA-L | ||
* common name: | * common name: | ||
** N-acetyl-α-D-glucosamine 1-phosphate | ** N-acetyl-α-D-glucosamine 1-phosphate | ||
− | |||
− | |||
* Synonym(s): | * Synonym(s): | ||
Line 17: | Line 17: | ||
* [[PHOSACETYLGLUCOSAMINEMUT-RXN]] | * [[PHOSACETYLGLUCOSAMINEMUT-RXN]] | ||
== External links == | == External links == | ||
− | |||
− | |||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57776 57776] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57776 57776] | ||
Line 24: | Line 22: | ||
* PUBCHEM: | * PUBCHEM: | ||
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25243937 25243937] | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25243937 25243937] | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C04256 C04256] | ||
* HMDB : HMDB01367 | * HMDB : HMDB01367 | ||
{{#set: smiles=CC(=O)NC1(C(O)C(O)C(CO)OC(OP(=O)([O-])[O-])1)}} | {{#set: smiles=CC(=O)NC1(C(O)C(O)C(CO)OC(OP(=O)([O-])[O-])1)}} | ||
+ | {{#set: molecular weight=299.174 }} | ||
{{#set: inchi key=InChIKey=FZLJPEPAYPUMMR-FMDGEEDCSA-L}} | {{#set: inchi key=InChIKey=FZLJPEPAYPUMMR-FMDGEEDCSA-L}} | ||
{{#set: common name=N-acetyl-α-D-glucosamine 1-phosphate}} | {{#set: common name=N-acetyl-α-D-glucosamine 1-phosphate}} | ||
− | |||
{{#set: produced by=RXN-16426}} | {{#set: produced by=RXN-16426}} | ||
{{#set: reversible reaction associated=PHOSACETYLGLUCOSAMINEMUT-RXN}} | {{#set: reversible reaction associated=PHOSACETYLGLUCOSAMINEMUT-RXN}} |
Latest revision as of 18:02, 9 January 2019
Contents
Metabolite N-ACETYL-D-GLUCOSAMINE-1-P
- smiles:
- CC(=O)NC1(C(O)C(O)C(CO)OC(OP(=O)([O-])[O-])1)
- molecular weight:
- 299.174
- inchi key:
- InChIKey=FZLJPEPAYPUMMR-FMDGEEDCSA-L
- common name:
- N-acetyl-α-D-glucosamine 1-phosphate
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(=O)NC1(C(O)C(O)C(CO)OC(OP(=O)([O-])[O-])1)" cannot be used as a page name in this wiki.