Difference between revisions of "CPD-201"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene CHC_T00008564001_1 == * Synonym(s): == Reactions associated == * PROTEIN-KINASE-RXN ** pantograph-galdieria.sulphuraria == Pathways asso...")
 
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene CHC_T00008564001_1 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-201 CPD-201] ==
 +
* smiles:
 +
** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(C1(=CC=C(O)C=C1))=O)COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-]
 +
* molecular weight:
 +
** 883.61   
 +
* inchi key:
 +
** InChIKey=LTVXPVBFJBTNIJ-TYHXJLICSA-J
 +
* common name:
 +
** 4-hydroxybenzoyl-CoA
 
* Synonym(s):
 
* Synonym(s):
 +
** p-hydroxybenzoyl-CoA
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* [[PROTEIN-KINASE-RXN]]
+
== Reaction(s) known to produce the compound ==
** [[pantograph]]-[[galdieria.sulphuraria]]
+
* [[RXN-11246]]
== Pathways associated ==
+
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
{{#set: reaction associated=PROTEIN-KINASE-RXN}}
+
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57356 57356]
 +
* PUBCHEM:
 +
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266585 45266585]
 +
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C02949 C02949]
 +
* HMDB : HMDB06467
 +
{{#set: smiles=CC(C)(C(O)C(=O)NCCC(=O)NCCSC(C1(=CC=C(O)C=C1))=O)COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-]}}
 +
{{#set: molecular weight=883.61    }}
 +
{{#set: inchi key=InChIKey=LTVXPVBFJBTNIJ-TYHXJLICSA-J}}
 +
{{#set: common name=4-hydroxybenzoyl-CoA}}
 +
{{#set: common name=p-hydroxybenzoyl-CoA}}
 +
{{#set: produced by=RXN-11246}}

Latest revision as of 16:49, 9 January 2019

Metabolite CPD-201

  • smiles:
    • CC(C)(C(O)C(=O)NCCC(=O)NCCSC(C1(=CC=C(O)C=C1))=O)COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-]
  • molecular weight:
    • 883.61
  • inchi key:
    • InChIKey=LTVXPVBFJBTNIJ-TYHXJLICSA-J
  • common name:
    • 4-hydroxybenzoyl-CoA
  • Synonym(s):
    • p-hydroxybenzoyl-CoA

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)(C(O)C(=O)NCCC(=O)NCCSC(C1(=CC=C(O)C=C1))=O)COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-" cannot be used as a page name in this wiki.