Difference between revisions of "DIMETHYLSULFONIOACETATE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9903 CPD-9903] == * smiles: ** CC(C)=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCC1(=C(C(=CC(C([O...") |
|||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIMETHYLSULFONIOACETATE DIMETHYLSULFONIOACETATE] == |
* smiles: | * smiles: | ||
− | ** | + | ** C(C(=O)[O-])[S+](C)C |
+ | * molecular weight: | ||
+ | ** 120.166 | ||
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=PSBDWGZCVUAZQS-UHFFFAOYSA-N |
* common name: | * common name: | ||
− | ** | + | ** dimethylsulfonioacetate |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** carboxymethyl-dimethyl-sulfonium |
− | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
+ | * [[2.1.1.3-RXN]] | ||
== External links == | == External links == | ||
− | |||
− | |||
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16471 16471] |
− | {{#set: smiles | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=160765 160765] |
− | {{#set: | + | * LIGAND-CPD: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C03392 C03392] |
− | {{#set: common name= | + | * CHEMSPIDER: |
− | {{#set: | + | ** [http://www.chemspider.com/Chemical-Structure.141257.html 141257] |
+ | {{#set: smiles=C(C(=O)[O-])[S+](C)C}} | ||
+ | {{#set: molecular weight=120.166 }} | ||
+ | {{#set: inchi key=InChIKey=PSBDWGZCVUAZQS-UHFFFAOYSA-N}} | ||
+ | {{#set: common name=dimethylsulfonioacetate}} | ||
+ | {{#set: common name=carboxymethyl-dimethyl-sulfonium}} | ||
+ | {{#set: reversible reaction associated=2.1.1.3-RXN}} |
Latest revision as of 16:49, 9 January 2019
Contents
Metabolite DIMETHYLSULFONIOACETATE
- smiles:
- C(C(=O)[O-])[S+](C)C
- molecular weight:
- 120.166
- inchi key:
- InChIKey=PSBDWGZCVUAZQS-UHFFFAOYSA-N
- common name:
- dimethylsulfonioacetate
- Synonym(s):
- carboxymethyl-dimethyl-sulfonium
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(C(=O)[O-])[S+](C)C" cannot be used as a page name in this wiki.