Difference between revisions of "CPD-7003"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7003 CPD-7003] == * smiles: ** CC(=CCCC(CCCC(CCCC(=CCOP([O-])(=O)OP([O-])(=O)[O-])C)C)C)C *...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** CC(=CCCC(CCCC(CCCC(=CCOP([O-])(=O)OP([O-])(=O)[O-])C)C)C)C | ** CC(=CCCC(CCCC(CCCC(=CCOP([O-])(=O)OP([O-])(=O)[O-])C)C)C)C | ||
| + | * molecular weight: | ||
| + | ** 451.456 | ||
* inchi key: | * inchi key: | ||
** InChIKey=VZBGWADXUJSBTI-PYDDKJGSSA-K | ** InChIKey=VZBGWADXUJSBTI-PYDDKJGSSA-K | ||
* common name: | * common name: | ||
** tetrahydrogeranylgeranyl diphosphate | ** tetrahydrogeranylgeranyl diphosphate | ||
| − | |||
| − | |||
* Synonym(s): | * Synonym(s): | ||
** tetrahydroGGPP | ** tetrahydroGGPP | ||
| Line 17: | Line 17: | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | |||
* [[RXN-7660]] | * [[RXN-7660]] | ||
| + | * [[RXN-7659]] | ||
== External links == | == External links == | ||
* PUBCHEM: | * PUBCHEM: | ||
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657275 90657275] | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657275 90657275] | ||
{{#set: smiles=CC(=CCCC(CCCC(CCCC(=CCOP([O-])(=O)OP([O-])(=O)[O-])C)C)C)C}} | {{#set: smiles=CC(=CCCC(CCCC(CCCC(=CCOP([O-])(=O)OP([O-])(=O)[O-])C)C)C)C}} | ||
| + | {{#set: molecular weight=451.456 }} | ||
{{#set: inchi key=InChIKey=VZBGWADXUJSBTI-PYDDKJGSSA-K}} | {{#set: inchi key=InChIKey=VZBGWADXUJSBTI-PYDDKJGSSA-K}} | ||
{{#set: common name=tetrahydrogeranylgeranyl diphosphate}} | {{#set: common name=tetrahydrogeranylgeranyl diphosphate}} | ||
| − | |||
{{#set: common name=tetrahydroGGPP|tetrahydrogeranylgeranyl pyrophosphate|tetrahydrogeranylgeranyl-PP}} | {{#set: common name=tetrahydroGGPP|tetrahydrogeranylgeranyl pyrophosphate|tetrahydrogeranylgeranyl-PP}} | ||
| − | {{#set: reversible reaction associated=RXN- | + | {{#set: reversible reaction associated=RXN-7660|RXN-7659}} |
Latest revision as of 17:10, 9 January 2019
Contents
Metabolite CPD-7003
- smiles:
- CC(=CCCC(CCCC(CCCC(=CCOP([O-])(=O)OP([O-])(=O)[O-])C)C)C)C
- molecular weight:
- 451.456
- inchi key:
- InChIKey=VZBGWADXUJSBTI-PYDDKJGSSA-K
- common name:
- tetrahydrogeranylgeranyl diphosphate
- Synonym(s):
- tetrahydroGGPP
- tetrahydrogeranylgeranyl pyrophosphate
- tetrahydrogeranylgeranyl-PP
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"CC(=CCCC(CCCC(CCCC(=CCOP([O-])(=O)OP([O-])(=O)[O-])C)C)C)C" cannot be used as a page name in this wiki.
