Difference between revisions of "CPD-10269"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10269 CPD-10269] == * smiles: ** CCCCCCC=CCCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(O...") |
|||
Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** CCCCCCC=CCCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-] | ** CCCCCCC=CCCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-] | ||
+ | * molecular weight: | ||
+ | ** 999.899 | ||
* inchi key: | * inchi key: | ||
** InChIKey=QBYOCCWNZAOZTL-MDMKAECGSA-J | ** InChIKey=QBYOCCWNZAOZTL-MDMKAECGSA-J | ||
* common name: | * common name: | ||
** palmitoleoyl-CoA | ** palmitoleoyl-CoA | ||
− | |||
− | |||
* Synonym(s): | * Synonym(s): | ||
** 16:1-delta9-CoA | ** 16:1-delta9-CoA | ||
Line 18: | Line 18: | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
* [[RXN-17019]] | * [[RXN-17019]] | ||
− | |||
− | |||
* [[RXN-10662]] | * [[RXN-10662]] | ||
+ | * [[RXN-17009]] | ||
+ | * [[RXN-17008]] | ||
* [[RXN-17788]] | * [[RXN-17788]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
− | |||
* [[RXN-10664]] | * [[RXN-10664]] | ||
+ | * [[RXN-17787]] | ||
+ | * [[RXN0-7248]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | |||
− | |||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61540 61540] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61540 61540] | ||
* METABOLIGHTS : MTBLC61540 | * METABOLIGHTS : MTBLC61540 | ||
+ | * PUBCHEM: | ||
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244393 25244393] | ||
{{#set: smiles=CCCCCCC=CCCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}} | {{#set: smiles=CCCCCCC=CCCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}} | ||
+ | {{#set: molecular weight=999.899 }} | ||
{{#set: inchi key=InChIKey=QBYOCCWNZAOZTL-MDMKAECGSA-J}} | {{#set: inchi key=InChIKey=QBYOCCWNZAOZTL-MDMKAECGSA-J}} | ||
{{#set: common name=palmitoleoyl-CoA}} | {{#set: common name=palmitoleoyl-CoA}} | ||
− | |||
{{#set: common name=16:1-delta9-CoA|9z-hexadecenoyl-CoA|cis-9-hexadecenoyl-CoA|palmitoleoyl coenzyme A|(9Z)-hexadec-9-enoyl-CoA}} | {{#set: common name=16:1-delta9-CoA|9z-hexadecenoyl-CoA|cis-9-hexadecenoyl-CoA|palmitoleoyl coenzyme A|(9Z)-hexadec-9-enoyl-CoA}} | ||
− | {{#set: consumed by=RXN-17019|RXN- | + | {{#set: consumed by=RXN-17019|RXN-10662|RXN-17009|RXN-17008|RXN-17788}} |
− | {{#set: produced by= | + | {{#set: produced by=RXN-10664|RXN-17787|RXN0-7248}} |
Latest revision as of 18:10, 9 January 2019
Contents
Metabolite CPD-10269
- smiles:
- CCCCCCC=CCCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
- molecular weight:
- 999.899
- inchi key:
- InChIKey=QBYOCCWNZAOZTL-MDMKAECGSA-J
- common name:
- palmitoleoyl-CoA
- Synonym(s):
- 16:1-delta9-CoA
- 9z-hexadecenoyl-CoA
- cis-9-hexadecenoyl-CoA
- palmitoleoyl coenzyme A
- (9Z)-hexadec-9-enoyl-CoA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCCCCCC=CCCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.