Difference between revisions of "L-DEHYDRO-ASCORBATE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-DEHYDRO-ASCORBATE L-DEHYDRO-ASCORBATE] == * smiles: ** C(O)C(O)C1(C(=O)C(=O)C(=O)O1) * inchi...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** C(O)C(O)C1(C(=O)C(=O)C(=O)O1) | ** C(O)C(O)C1(C(=O)C(=O)C(=O)O1) | ||
| + | * molecular weight: | ||
| + | ** 174.11 | ||
* inchi key: | * inchi key: | ||
** InChIKey=SBJKKFFYIZUCET-SZSCBOSDSA-N | ** InChIKey=SBJKKFFYIZUCET-SZSCBOSDSA-N | ||
* common name: | * common name: | ||
** L-dehydro-ascorbate | ** L-dehydro-ascorbate | ||
| − | |||
| − | |||
* Synonym(s): | * Synonym(s): | ||
** dehydroascorbate | ** dehydroascorbate | ||
| Line 15: | Line 15: | ||
* [[1.8.5.1-RXN]] | * [[1.8.5.1-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
* [[RXN-12440]] | * [[RXN-12440]] | ||
| + | * [[DOPAMINE-BETA-MONOOXYGENASE-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | |||
| − | |||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58070 58070] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58070 58070] | ||
| Line 26: | Line 24: | ||
* PUBCHEM: | * PUBCHEM: | ||
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=15558810 15558810] | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=15558810 15558810] | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C05422 C05422] | ||
* HMDB : HMDB01264 | * HMDB : HMDB01264 | ||
{{#set: smiles=C(O)C(O)C1(C(=O)C(=O)C(=O)O1)}} | {{#set: smiles=C(O)C(O)C1(C(=O)C(=O)C(=O)O1)}} | ||
| + | {{#set: molecular weight=174.11 }} | ||
{{#set: inchi key=InChIKey=SBJKKFFYIZUCET-SZSCBOSDSA-N}} | {{#set: inchi key=InChIKey=SBJKKFFYIZUCET-SZSCBOSDSA-N}} | ||
{{#set: common name=L-dehydro-ascorbate}} | {{#set: common name=L-dehydro-ascorbate}} | ||
| − | |||
{{#set: common name=dehydroascorbate}} | {{#set: common name=dehydroascorbate}} | ||
{{#set: consumed by=1.8.5.1-RXN}} | {{#set: consumed by=1.8.5.1-RXN}} | ||
| − | {{#set: produced by=DOPAMINE-BETA-MONOOXYGENASE-RXN | + | {{#set: produced by=RXN-12440|DOPAMINE-BETA-MONOOXYGENASE-RXN}} |
Latest revision as of 17:13, 9 January 2019
Contents
Metabolite L-DEHYDRO-ASCORBATE
- smiles:
- C(O)C(O)C1(C(=O)C(=O)C(=O)O1)
- molecular weight:
- 174.11
- inchi key:
- InChIKey=SBJKKFFYIZUCET-SZSCBOSDSA-N
- common name:
- L-dehydro-ascorbate
- Synonym(s):
- dehydroascorbate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
