Difference between revisions of "FRU1P"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=FRU1P FRU1P] == * smiles: ** C(O)C1(C(O)C(O)C(COP([O-])([O-])=O)(O)O1) * inchi key: ** InChIKey...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** C(O)C1(C(O)C(O)C(COP([O-])([O-])=O)(O)O1) | ** C(O)C1(C(O)C(O)C(COP([O-])([O-])=O)(O)O1) | ||
| + | * molecular weight: | ||
| + | ** 258.121 | ||
* inchi key: | * inchi key: | ||
** InChIKey=RHKKZBWRNHGJEZ-ARQDHWQXSA-L | ** InChIKey=RHKKZBWRNHGJEZ-ARQDHWQXSA-L | ||
* common name: | * common name: | ||
** β-D-fructofuranose 1-phosphate | ** β-D-fructofuranose 1-phosphate | ||
| − | |||
| − | |||
* Synonym(s): | * Synonym(s): | ||
** β-D-fructofuranose-1-P | ** β-D-fructofuranose-1-P | ||
| Line 17: | Line 17: | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | * | + | * BIGG : f1p |
* PUBCHEM: | * PUBCHEM: | ||
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244216 25244216] | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244216 25244216] | ||
| − | * | + | * CAS : 15978-08-2 |
{{#set: smiles=C(O)C1(C(O)C(O)C(COP([O-])([O-])=O)(O)O1)}} | {{#set: smiles=C(O)C1(C(O)C(O)C(COP([O-])([O-])=O)(O)O1)}} | ||
| + | {{#set: molecular weight=258.121 }} | ||
{{#set: inchi key=InChIKey=RHKKZBWRNHGJEZ-ARQDHWQXSA-L}} | {{#set: inchi key=InChIKey=RHKKZBWRNHGJEZ-ARQDHWQXSA-L}} | ||
{{#set: common name=β-D-fructofuranose 1-phosphate}} | {{#set: common name=β-D-fructofuranose 1-phosphate}} | ||
| − | |||
{{#set: common name=β-D-fructofuranose-1-P}} | {{#set: common name=β-D-fructofuranose-1-P}} | ||
{{#set: consumed by=RXN-8631}} | {{#set: consumed by=RXN-8631}} | ||
Latest revision as of 17:16, 9 January 2019
Contents
Metabolite FRU1P
- smiles:
- C(O)C1(C(O)C(O)C(COP([O-])([O-])=O)(O)O1)
- molecular weight:
- 258.121
- inchi key:
- InChIKey=RHKKZBWRNHGJEZ-ARQDHWQXSA-L
- common name:
- β-D-fructofuranose 1-phosphate
- Synonym(s):
- β-D-fructofuranose-1-P
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- BIGG : f1p
- PUBCHEM:
- CAS : 15978-08-2
"C(O)C1(C(O)C(O)C(COP([O-])([O-])=O)(O)O1)" cannot be used as a page name in this wiki.
