Difference between revisions of "OXALO-SUCCINATE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=OXALO-SUCCINATE OXALO-SUCCINATE] == * smiles: ** C(C([O-])=O)C(C(C(=O)[O-])=O)C([O-])=O * inchi...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** C(C([O-])=O)C(C(C(=O)[O-])=O)C([O-])=O | ** C(C([O-])=O)C(C(C(=O)[O-])=O)C([O-])=O | ||
| + | * molecular weight: | ||
| + | ** 187.085 | ||
* inchi key: | * inchi key: | ||
** InChIKey=UFSCUAXLTRFIDC-UHFFFAOYSA-K | ** InChIKey=UFSCUAXLTRFIDC-UHFFFAOYSA-K | ||
* common name: | * common name: | ||
** oxalosuccinate | ** oxalosuccinate | ||
| − | |||
| − | |||
* Synonym(s): | * Synonym(s): | ||
** oxalo-succ | ** oxalo-succ | ||
| Line 15: | Line 15: | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | |||
* [[RXN-9951]] | * [[RXN-9951]] | ||
| + | * [[RXN-8642]] | ||
== External links == | == External links == | ||
| − | |||
| − | |||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58931 58931] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58931 58931] | ||
| Line 25: | Line 23: | ||
* PUBCHEM: | * PUBCHEM: | ||
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244267 25244267] | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244267 25244267] | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C05379 C05379] | ||
* HMDB : HMDB03974 | * HMDB : HMDB03974 | ||
{{#set: smiles=C(C([O-])=O)C(C(C(=O)[O-])=O)C([O-])=O}} | {{#set: smiles=C(C([O-])=O)C(C(C(=O)[O-])=O)C([O-])=O}} | ||
| + | {{#set: molecular weight=187.085 }} | ||
{{#set: inchi key=InChIKey=UFSCUAXLTRFIDC-UHFFFAOYSA-K}} | {{#set: inchi key=InChIKey=UFSCUAXLTRFIDC-UHFFFAOYSA-K}} | ||
{{#set: common name=oxalosuccinate}} | {{#set: common name=oxalosuccinate}} | ||
| − | |||
{{#set: common name=oxalo-succ}} | {{#set: common name=oxalo-succ}} | ||
| − | {{#set: reversible reaction associated=RXN- | + | {{#set: reversible reaction associated=RXN-9951|RXN-8642}} |
Latest revision as of 17:21, 9 January 2019
Contents
Metabolite OXALO-SUCCINATE
- smiles:
- C(C([O-])=O)C(C(C(=O)[O-])=O)C([O-])=O
- molecular weight:
- 187.085
- inchi key:
- InChIKey=UFSCUAXLTRFIDC-UHFFFAOYSA-K
- common name:
- oxalosuccinate
- Synonym(s):
- oxalo-succ
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(C([O-])=O)C(C(C(=O)[O-])=O)C([O-])=O" cannot be used as a page name in this wiki.
