Difference between revisions of "CPD-9446"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9446 CPD-9446] == * smiles: ** C(O)C1(OCC(O)C(O)C(O)1) * inchi key: ** InChIKey=MPCAJMNYNOG...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** C(O)C1(OCC(O)C(O)C(O)1) | ** C(O)C1(OCC(O)C(O)C(O)1) | ||
| + | * molecular weight: | ||
| + | ** 164.158 | ||
* inchi key: | * inchi key: | ||
** InChIKey=MPCAJMNYNOGXPB-KVTDHHQDSA-N | ** InChIKey=MPCAJMNYNOGXPB-KVTDHHQDSA-N | ||
* common name: | * common name: | ||
** 1,5-anhydro-D-mannitol | ** 1,5-anhydro-D-mannitol | ||
| − | |||
| − | |||
* Synonym(s): | * Synonym(s): | ||
** 1,5-anhydromannitol | ** 1,5-anhydromannitol | ||
| Line 17: | Line 17: | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | |||
| − | |||
| − | |||
| − | |||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=49182 49182] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=49182 49182] | ||
| + | * PUBCHEM: | ||
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=445184 445184] | ||
* LIGAND-CPD: | * LIGAND-CPD: | ||
** [http://www.genome.jp/dbget-bin/www_bget?C16538 C16538] | ** [http://www.genome.jp/dbget-bin/www_bget?C16538 C16538] | ||
| + | * CHEMSPIDER: | ||
| + | ** [http://www.chemspider.com/Chemical-Structure.392897.html 392897] | ||
{{#set: smiles=C(O)C1(OCC(O)C(O)C(O)1)}} | {{#set: smiles=C(O)C1(OCC(O)C(O)C(O)1)}} | ||
| + | {{#set: molecular weight=164.158 }} | ||
{{#set: inchi key=InChIKey=MPCAJMNYNOGXPB-KVTDHHQDSA-N}} | {{#set: inchi key=InChIKey=MPCAJMNYNOGXPB-KVTDHHQDSA-N}} | ||
{{#set: common name=1,5-anhydro-D-mannitol}} | {{#set: common name=1,5-anhydro-D-mannitol}} | ||
| − | |||
{{#set: common name=1,5-anhydromannitol}} | {{#set: common name=1,5-anhydromannitol}} | ||
{{#set: consumed by=RXN-13064}} | {{#set: consumed by=RXN-13064}} | ||
Latest revision as of 17:24, 9 January 2019
Contents
Metabolite CPD-9446
- smiles:
- C(O)C1(OCC(O)C(O)C(O)1)
- molecular weight:
- 164.158
- inchi key:
- InChIKey=MPCAJMNYNOGXPB-KVTDHHQDSA-N
- common name:
- 1,5-anhydro-D-mannitol
- Synonym(s):
- 1,5-anhydromannitol
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
