Difference between revisions of "CHC T00008752001"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=7-METHYLXANTHINE 7-METHYLXANTHINE] == * smiles: ** CN1(C=NC2(NC(=O)NC(=O)C1=2)) * inchi key: **...")
 
(Created page with "Category:Gene == Gene CHC_T00008752001 == * left end position: ** 24505 * transcription direction: ** NEGATIVE * right end position: ** 25662 * centisome position: ** 59.3...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=7-METHYLXANTHINE 7-METHYLXANTHINE] ==
+
== Gene CHC_T00008752001 ==
−
* smiles:
+
* left end position:
−
** CN1(C=NC2(NC(=O)NC(=O)C1=2))
+
** 24505
−
* inchi key:
+
* transcription direction:
−
** InChIKey=PFWLFWPASULGAN-UHFFFAOYSA-N
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** 7-methylxanthine
+
** 25662
−
* molecular weight:
+
* centisome position:
−
** 166.139    
+
** 59.30255    
 
* Synonym(s):
 
* Synonym(s):
−
** heteroxanthine
 
−
** 3,7-dihydro-7-methyl-1H-purine-2,6-dione
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-11521]]
+
* Reaction: [[2.7.12.2-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-original_genome]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: automated-name-match
 +
* Reaction: [[RXN-16317]]
 +
** Source: [[annotation-original_genome]]
 +
*** Assignment: automated-name-match
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=24505}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=68374 68374]
+
{{#set: transcription direction=NEGATIVE}}
−
* CHEMSPIDER:
+
{{#set: right end position=25662}}
−
** [http://www.chemspider.com/Chemical-Structure.61660.html 61660]
+
{{#set: centisome position=59.30255   }}
−
* CHEBI:
+
{{#set: reaction associated=2.7.12.2-RXN|RXN-16317}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=48991 48991]
+
−
* LIGAND-CPD:
+
−
** [http://www.genome.jp/dbget-bin/www_bget?C16353 C16353]
+
−
* HMDB : HMDB01991
+
−
{{#set: smiles=CN1(C=NC2(NC(=O)NC(=O)C1=2))}}
+
−
{{#set: inchi key=InChIKey=PFWLFWPASULGAN-UHFFFAOYSA-N}}
+
−
{{#set: common name=7-methylxanthine}}
+
−
{{#set: molecular weight=166.139   }}
+
−
{{#set: common name=heteroxanthine|3,7-dihydro-7-methyl-1H-purine-2,6-dione}}
+
−
{{#set: consumed by=RXN-11521}}
+

Latest revision as of 14:52, 23 May 2018

Gene CHC_T00008752001

  • left end position:
    • 24505
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 25662
  • centisome position:
    • 59.30255
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=CHC_T00008752001&oldid=12381"