Difference between revisions of "PWY-6537"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19170 CPD-19170] == * smiles: ** CCCCCCCCC=CCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(...")
 
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19170 CPD-19170] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6537 PWY-6537] ==
* smiles:
+
** CCCCCCCCC=CCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
* inchi key:
+
** InChIKey=YQARRKBGBKPBCX-DVZFGLDUSA-J
+
 
* common name:
 
* common name:
** (2E,7Z)-hexadecenoyl-CoA
+
** 4-aminobutanoate degradation II
* molecular weight:
+
* taxonomic range:
** 997.883   
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
 
* Synonym(s):
 
* Synonym(s):
** 16:2-Δ2,Δ7-CoA
 
** 2-trans,7-cis-hexadecenoyl-CoA
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
* [[RXN-17780]]
+
'''1''' reactions found over '''2''' reactions in the full pathway
== Reaction(s) known to produce the compound ==
+
* [[SUCCSEMIALDDEHYDROG-RXN]]
* [[RXN-17779]]
+
** 1 associated gene(s):
== Reaction(s) of unknown directionality ==
+
*** [[CHC_T00008575001]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-original_genome]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=GABATRANSAM-RXN GABATRANSAM-RXN]
 
== External links  ==
 
== External links  ==
{{#set: smiles=CCCCCCCCC=CCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
* ECOCYC:
{{#set: inchi key=InChIKey=YQARRKBGBKPBCX-DVZFGLDUSA-J}}
+
** [http://metacyc.org/ECOLI/NEW-IMAGE?object=PWY-6537 PWY-6537]
{{#set: common name=(2E,7Z)-hexadecenoyl-CoA}}
+
{{#set: common name=4-aminobutanoate degradation II}}
{{#set: molecular weight=997.883    }}
+
{{#set: taxonomic range=TAX-4751}}
{{#set: common name=16:2-Δ2,Δ7-CoA|2-trans,7-cis-hexadecenoyl-CoA}}
+
{{#set: taxonomic range=TAX-2}}
{{#set: consumed by=RXN-17780}}
+
{{#set: reaction found=1}}
{{#set: produced by=RXN-17779}}
+
{{#set: total reaction=2}}
 +
{{#set: completion rate=50.0}}

Latest revision as of 16:40, 9 January 2019

Pathway PWY-6537

  • common name:
    • 4-aminobutanoate degradation II
  • taxonomic range:
  • Synonym(s):

Reaction(s) found

1 reactions found over 2 reactions in the full pathway

Reaction(s) not found

External links