Difference between revisions of "RXN-10711"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10600 CPD-10600] == * smiles: ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CC(=O)C1(C=CC(O)=CC=1))COP...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10711 RXN-10711] == * direction: ** LEFT-TO-RIGHT * common name: ** Carboxylesterase * ec numbe...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10600 CPD-10600] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10711 RXN-10711] ==
−
* smiles:
+
* direction:
−
** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CC(=O)C1(C=CC(O)=CC=1))COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-]
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=OVQOJJJXNYHOPR-FUEUKBNZSA-J
+
 
* common name:
 
* common name:
−
** 4-hydroxybenzoyl-acetyl-CoA
+
** Carboxylesterase
−
* molecular weight:
+
* ec number:
−
** 925.647   
+
** [http://enzyme.expasy.org/EC/3.1.1.1 EC-3.1.1.1]
 
* Synonym(s):
 
* Synonym(s):
−
** 3-(4-hydroxyphenyl)-3-oxo-propanoyl-CoA
 
−
** 3-(4-hydroxyphenyl)-3-keto-propanoyl-CoA
 
−
** 3-(4-hydroxyphenyl)-3-keto-propionyl-CoA
 
−
** 3-(4-hydroxyphenyl)-3-oxo-propionyl-CoA
 
−
** p-hydroxybenzoyl-acetyl-CoA
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-11246]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[WATER]][c] '''+''' 1 [[CPD-10546]][c] '''=>''' 1 [[PROTON]][c] '''+''' 1 [[METOH]][c] '''+''' 1 [[INDOLE_ACETATE_AUXIN]][c]
−
* [[RXN-11245]]
+
* With common name(s):
−
== Reaction(s) of unknown directionality ==
+
** 1 H2O[c] '''+''' 1 methyl (indol-3-yl)acetate[c] '''=>''' 1 H+[c] '''+''' 1 methanol[c] '''+''' 1 indole-3-acetate[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[CHC_T00003680001_1]]
 +
** Source: [[orthology-ectocarpus_siliculosus]]
 +
* Gene: [[CHC_T00000998001_1]]
 +
** Source: [[orthology-ectocarpus_siliculosus]]
 +
* Gene: [[CHC_T00008784001]]
 +
** Source: [[annotation-original_genome]]
 +
*** Assignment: AUTOMATED-NAME-MATCH
 +
== Pathways  ==
 +
* [[PWY-6303]], methyl indole-3-acetate interconversion: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6303 PWY-6303]
 +
** '''1''' reactions found over '''2''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-ectocarpus_siliculosus]]
 +
*** Tool: [[pantograph]]
 +
* Category: [[annotation]]
 +
** Source: [[annotation-original_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25200630 25200630]
+
{{#set: common name=Carboxylesterase}}
−
{{#set: smiles=CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CC(=O)C1(C=CC(O)=CC=1))COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-]}}
+
{{#set: ec number=EC-3.1.1.1}}
−
{{#set: inchi key=InChIKey=OVQOJJJXNYHOPR-FUEUKBNZSA-J}}
+
{{#set: gene associated=CHC_T00003680001_1|CHC_T00000998001_1|CHC_T00008784001}}
−
{{#set: common name=4-hydroxybenzoyl-acetyl-CoA}}
+
{{#set: in pathway=PWY-6303}}
−
{{#set: molecular weight=925.647    }}
+
{{#set: reconstruction category=orthology|annotation}}
−
{{#set: common name=3-(4-hydroxyphenyl)-3-oxo-propanoyl-CoA|3-(4-hydroxyphenyl)-3-keto-propanoyl-CoA|3-(4-hydroxyphenyl)-3-keto-propionyl-CoA|3-(4-hydroxyphenyl)-3-oxo-propionyl-CoA|p-hydroxybenzoyl-acetyl-CoA}}
+
{{#set: reconstruction source=annotation-original_genome|orthology-ectocarpus_siliculosus}}
−
{{#set: consumed by=RXN-11246}}
+
{{#set: reconstruction tool=pantograph|pathwaytools}}
−
{{#set: produced by=RXN-11245}}
+

Latest revision as of 15:19, 23 May 2018

Reaction RXN-10711

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • Carboxylesterase
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-6303, methyl indole-3-acetate interconversion: PWY-6303
    • 1 reactions found over 2 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=RXN-10711&oldid=13966"