Difference between revisions of "Cytochromes-C-Oxidized"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17371 CPD-17371] == * smiles: ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CCCCCCCC=CCC=CCCCCCO)COP(=...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Cytochromes-C-Oxidized Cytochromes-C-Oxidized] == * common name: ** an oxidized c-type cytochro...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17371 CPD-17371] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Cytochromes-C-Oxidized Cytochromes-C-Oxidized] ==
−
* smiles:
+
−
** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CCCCCCCC=CCC=CCCCCCO)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
−
* inchi key:
+
−
** InChIKey=HJEGYLSHIKPENR-DAXVLCLXSA-J
+
 
* common name:
 
* common name:
−
** 18-hydroxylinoleoyl-CoA
+
** an oxidized c-type cytochrome
−
* molecular weight:
+
−
** 1041.936   
+
 
* Synonym(s):
 
* Synonym(s):
−
** ω-hydroxylinoleoyl-CoA
+
** a ferri c-type cytochrome
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[RXN-16118]]
+
* [[RXN-14107]]
 +
* [[RXN-15816]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-15830]]
 +
* [[CYTOCHROME-C-PEROXIDASE-RXN]]
 +
* [[CYTOCHROME-C-OXIDASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 +
* [[1.10.2.2-RXN]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: common name=an oxidized c-type cytochrome}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90659898 90659898]
+
{{#set: common name=a ferri c-type cytochrome}}
−
* CHEBI:
+
{{#set: consumed by=RXN-14107|RXN-15816}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=84904 84904]
+
{{#set: produced by=RXN-15830|CYTOCHROME-C-PEROXIDASE-RXN|CYTOCHROME-C-OXIDASE-RXN}}
−
{{#set: smiles=CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CCCCCCCC=CCC=CCCCCCO)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: reversible reaction associated=1.10.2.2-RXN}}
−
{{#set: inchi key=InChIKey=HJEGYLSHIKPENR-DAXVLCLXSA-J}}
+
−
{{#set: common name=18-hydroxylinoleoyl-CoA}}
+
−
{{#set: molecular weight=1041.936    }}
+
−
{{#set: common name=ω-hydroxylinoleoyl-CoA}}
+
−
{{#set: consumed by=RXN-16118}}
+

Latest revision as of 16:19, 23 May 2018

Metabolite Cytochromes-C-Oxidized

  • common name:
    • an oxidized c-type cytochrome
  • Synonym(s):
    • a ferri c-type cytochrome

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=Cytochromes-C-Oxidized&oldid=13976"