Difference between revisions of "CPD-14927"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12614 RXN-12614] == * direction: ** LEFT-TO-RIGHT * Synonym(s): == Reaction Formula == * With...")
 
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12614 RXN-12614] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14927 CPD-14927] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CC(C)CCCC(C)CCCC(C)CCCC(C)=CC(=O)[O-]
 +
* molecular weight:
 +
** 309.511   
 +
* inchi key:
 +
** InChIKey=WDWBNNBRPVEEOD-PFXVRADUSA-M
 +
* common name:
 +
** phytenate
 
* Synonym(s):
 
* Synonym(s):
 +
** 2E-phytenate
 +
** 2E-phytenic acid
 +
** 3,7,11,15-tetramethyl-2E-hexadecenoic acid
 +
** (E)-3,7,11,15-tetramethylhexadec-2-enoic acid
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN66-480]]
−
** 1 [[GLY]][c] '''+''' 1 [[OXYGEN-MOLECULE]][c] '''=>''' 1 [[PROTON]][c] '''+''' 1 [[CPD-12279]][c] '''+''' 1 [[HYDROGEN-PEROXIDE]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
* [[RXN66-479]]
−
** 1 glycine[c] '''+''' 1 oxygen[c] '''=>''' 1 H+[c] '''+''' 1 2-iminoacetate[c] '''+''' 1 hydrogen peroxide[c]
+
== Reaction(s) of unknown directionality ==
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[CHC_T00001330001_1]]
+
−
** [[pantograph]]-[[galdieria.sulphuraria]]
+
−
== Pathways  ==
+
−
* [[PWY-6891]], thiazole biosynthesis II (aerobic bacteria): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6891 PWY-6891]
+
−
** '''3''' reactions found over '''7''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[galdieria.sulphuraria]]
+
 
== External links  ==
 
== External links  ==
−
* RHEA:
+
* PUBCHEM:
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=33343 33343]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=40561589 40561589]
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* LIPID_MAPS : LMPR0104010024
−
{{#set: gene associated=CHC_T00001330001_1}}
+
* CHEMSPIDER:
−
{{#set: in pathway=PWY-6891}}
+
** [http://www.chemspider.com/Chemical-Structure.4471755.html 4471755]
−
{{#set: reconstruction category=orthology}}
+
{{#set: smiles=CC(C)CCCC(C)CCCC(C)CCCC(C)=CC(=O)[O-]}}
−
{{#set: reconstruction tool=pantograph}}
+
{{#set: molecular weight=309.511    }}
−
{{#set: reconstruction source=galdieria.sulphuraria}}
+
{{#set: inchi key=InChIKey=WDWBNNBRPVEEOD-PFXVRADUSA-M}}
 +
{{#set: common name=phytenate}}
 +
{{#set: common name=2E-phytenate|2E-phytenic acid|3,7,11,15-tetramethyl-2E-hexadecenoic acid|(E)-3,7,11,15-tetramethylhexadec-2-enoic acid}}
 +
{{#set: consumed by=RXN66-480}}
 +
{{#set: produced by=RXN66-479}}

Latest revision as of 16:52, 9 January 2019

Metabolite CPD-14927

  • smiles:
    • CC(C)CCCC(C)CCCC(C)CCCC(C)=CC(=O)[O-]
  • molecular weight:
    • 309.511
  • inchi key:
    • InChIKey=WDWBNNBRPVEEOD-PFXVRADUSA-M
  • common name:
    • phytenate
  • Synonym(s):
    • 2E-phytenate
    • 2E-phytenic acid
    • 3,7,11,15-tetramethyl-2E-hexadecenoic acid
    • (E)-3,7,11,15-tetramethylhexadec-2-enoic acid

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)CCCC(C)CCCC(C)CCCC(C)=CC(=O)[O-" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=CPD-14927&oldid=20920"