Difference between revisions of "DIVINYL-PROTOCHLOROPHYLLIDE-A"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIVINYL-PROTOCHLOROPHYLLIDE-A DIVINYL-PROTOCHLOROPHYLLIDE-A] == * smiles: ** C=CC2(C(C)=C4(C=C9...") |
|||
Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** C=CC2(C(C)=C4(C=C9(C(C)=C(CCC(=O)[O-])C5(=N([Mg]36(N1(=C(C(C=C)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9)))) | ** C=CC2(C(C)=C4(C=C9(C(C)=C(CCC(=O)[O-])C5(=N([Mg]36(N1(=C(C(C=C)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9)))) | ||
− | |||
− | |||
* molecular weight: | * molecular weight: | ||
** 608.935 | ** 608.935 | ||
+ | * common name: | ||
+ | ** 3,8-divinyl protochlorophyllide a | ||
* Synonym(s): | * Synonym(s): | ||
** divinylprotochlorophyllide | ** divinylprotochlorophyllide | ||
Line 13: | Line 13: | ||
* [[RXN-5285]] | * [[RXN-5285]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
* [[RXN-5284]] | * [[RXN-5284]] | ||
+ | * [[RXN-13191]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
* [[RXN1F-72]] | * [[RXN1F-72]] | ||
== External links == | == External links == | ||
− | |||
− | |||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58632 58632] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58632 58632] | ||
+ | * PUBCHEM: | ||
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=54743931 54743931] | ||
* LIGAND-CPD: | * LIGAND-CPD: | ||
** [http://www.genome.jp/dbget-bin/www_bget?C11831 C11831] | ** [http://www.genome.jp/dbget-bin/www_bget?C11831 C11831] | ||
{{#set: smiles=C=CC2(C(C)=C4(C=C9(C(C)=C(CCC(=O)[O-])C5(=N([Mg]36(N1(=C(C(C=C)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))}} | {{#set: smiles=C=CC2(C(C)=C4(C=C9(C(C)=C(CCC(=O)[O-])C5(=N([Mg]36(N1(=C(C(C=C)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))}} | ||
− | |||
{{#set: molecular weight=608.935 }} | {{#set: molecular weight=608.935 }} | ||
+ | {{#set: common name=3,8-divinyl protochlorophyllide a}} | ||
{{#set: common name=divinylprotochlorophyllide}} | {{#set: common name=divinylprotochlorophyllide}} | ||
{{#set: consumed by=RXN-5285}} | {{#set: consumed by=RXN-5285}} | ||
− | {{#set: produced by=RXN- | + | {{#set: produced by=RXN-5284|RXN-13191}} |
{{#set: reversible reaction associated=RXN1F-72}} | {{#set: reversible reaction associated=RXN1F-72}} |
Latest revision as of 18:40, 9 January 2019
Contents
Metabolite DIVINYL-PROTOCHLOROPHYLLIDE-A
- smiles:
- C=CC2(C(C)=C4(C=C9(C(C)=C(CCC(=O)[O-])C5(=N([Mg]36(N1(=C(C(C=C)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))
- molecular weight:
- 608.935
- common name:
- 3,8-divinyl protochlorophyllide a
- Synonym(s):
- divinylprotochlorophyllide
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C=CC2(C(C)=C4(C=C9(C(C)=C(CCC(=O)[O-])C5(=N([Mg]36(N1(=C(C(C=C)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))" cannot be used as a page name in this wiki.