Difference between revisions of "CPD-2041"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-2041 CPD-2041] == * smiles: ** CC(C)C([N+])CC([O-])=O * common name: ** (3R)-β-leucine...") |
|||
Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** CC(C)C([N+])CC([O-])=O | ** CC(C)C([N+])CC([O-])=O | ||
− | |||
− | |||
− | |||
− | |||
* molecular weight: | * molecular weight: | ||
** 131.174 | ** 131.174 | ||
+ | * inchi key: | ||
+ | ** InChIKey=GLUJNGJDHCTUJY-RXMQYKEDSA-N | ||
+ | * common name: | ||
+ | ** (3R)-β-leucine | ||
* Synonym(s): | * Synonym(s): | ||
** β-homovaline | ** β-homovaline | ||
Line 22: | Line 22: | ||
* [[LEUCINE-23-AMINOMUTASE-RXN]] | * [[LEUCINE-23-AMINOMUTASE-RXN]] | ||
== External links == | == External links == | ||
− | |||
− | |||
− | |||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57428 57428] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57428 57428] | ||
+ | * PUBCHEM: | ||
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6934188 6934188] | ||
* LIGAND-CPD: | * LIGAND-CPD: | ||
** [http://www.genome.jp/dbget-bin/www_bget?C02486 C02486] | ** [http://www.genome.jp/dbget-bin/www_bget?C02486 C02486] | ||
+ | * HMDB : HMDB03640 | ||
{{#set: smiles=CC(C)C([N+])CC([O-])=O}} | {{#set: smiles=CC(C)C([N+])CC([O-])=O}} | ||
− | |||
− | |||
{{#set: molecular weight=131.174 }} | {{#set: molecular weight=131.174 }} | ||
+ | {{#set: inchi key=InChIKey=GLUJNGJDHCTUJY-RXMQYKEDSA-N}} | ||
+ | {{#set: common name=(3R)-β-leucine}} | ||
{{#set: common name=β-homovaline|(3R)-β-2-amino-4-methylvaleric acid|L-β-leucine|3-amino-4-methylpentanoate|β-leucine}} | {{#set: common name=β-homovaline|(3R)-β-2-amino-4-methylvaleric acid|L-β-leucine|3-amino-4-methylpentanoate|β-leucine}} | ||
{{#set: consumed by=RXN-7690}} | {{#set: consumed by=RXN-7690}} | ||
{{#set: reversible reaction associated=LEUCINE-23-AMINOMUTASE-RXN}} | {{#set: reversible reaction associated=LEUCINE-23-AMINOMUTASE-RXN}} |
Latest revision as of 18:43, 9 January 2019
Contents
Metabolite CPD-2041
- smiles:
- CC(C)C([N+])CC([O-])=O
- molecular weight:
- 131.174
- inchi key:
- InChIKey=GLUJNGJDHCTUJY-RXMQYKEDSA-N
- common name:
- (3R)-β-leucine
- Synonym(s):
- β-homovaline
- (3R)-β-2-amino-4-methylvaleric acid
- L-β-leucine
- 3-amino-4-methylpentanoate
- β-leucine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)C([N+])CC([O-])=O" cannot be used as a page name in this wiki.