Difference between revisions of "CHC T00002689001 1"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1028 CPD0-1028] == * smiles: ** CC(=CCCC(C)=CCCC(C)=CCCC(C)=CCOP(=O)([O-])OP(=O)([O-])[O-]...")
 
(Created page with "Category:Gene == Gene CHC_T00002689001_1 == * Synonym(s): == Reactions associated == * Reaction: RXN-11334 ** Source: orthology-ectocarpus_siliculosus == Pathways...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1028 CPD0-1028] ==
+
== Gene CHC_T00002689001_1 ==
* smiles:
+
** CC(=CCCC(C)=CCCC(C)=CCCC(C)=CCOP(=O)([O-])OP(=O)([O-])[O-])C
+
* inchi key:
+
** InChIKey=OINNEUNVOZHBOX-KWBDAJKESA-K
+
* common name:
+
** 2-cis,6-trans,10-trans-geranylgeranyl diphosphate
+
* molecular weight:
+
** 447.424   
+
 
* Synonym(s):
 
* Synonym(s):
** di-trans,poly-cis-geranylgeranyl diphosphate
 
** ω,E,E,Z-geranylgeranyl diphosphate
 
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
== Reaction(s) known to produce the compound ==
+
* Reaction: [[RXN-11334]]
== Reaction(s) of unknown directionality ==
+
** Source: [[orthology-ectocarpus_siliculosus]]
* [[RXN0-5180]]
+
== Pathways associated ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: reaction associated=RXN-11334}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245826 25245826]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62639 62639]
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C11356 C11356]
+
{{#set: smiles=CC(=CCCC(C)=CCCC(C)=CCCC(C)=CCOP(=O)([O-])OP(=O)([O-])[O-])C}}
+
{{#set: inchi key=InChIKey=OINNEUNVOZHBOX-KWBDAJKESA-K}}
+
{{#set: common name=2-cis,6-trans,10-trans-geranylgeranyl diphosphate}}
+
{{#set: molecular weight=447.424    }}
+
{{#set: common name=di-trans,poly-cis-geranylgeranyl diphosphate|ω,E,E,Z-geranylgeranyl diphosphate}}
+
{{#set: consumed or produced by=RXN0-5180}}
+

Latest revision as of 15:20, 23 May 2018

Gene CHC_T00002689001_1

  • Synonym(s):

Reactions associated

Pathways associated

External links